CAS 1112-55-6: Tetraethenylsilane
Description:Tetraethenylsilane, with the CAS number 1112-55-6, is an organosilicon compound characterized by its four ethene (vinyl) groups attached to a silicon atom. This structure imparts unique properties, making it a versatile compound in various applications, particularly in polymer chemistry and materials science. Tetraethenylsilane is typically a colorless liquid at room temperature and is known for its reactivity due to the presence of multiple double bonds, which can undergo polymerization and cross-linking reactions. This reactivity allows it to be used as a monomer in the synthesis of silicone-based polymers and as a coupling agent to enhance the adhesion of materials. Additionally, it exhibits good thermal stability and resistance to moisture, making it suitable for use in harsh environments. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose risks such as skin and eye irritation. Overall, tetraethenylsilane is a valuable compound in the development of advanced materials and coatings.
Formula:C8H12Si
InChI:InChI=1S/C8H12Si/c1-5-9(6-2,7-3)8-4/h5-8H,1-4H2
InChI key:InChIKey=UFHILTCGAOPTOV-UHFFFAOYSA-N
SMILES:C=C[Si](C=C)(C=C)C=C
- Synonyms:
- Nsc 113262
- Silane, tetraethenyl-
- Silane, tetravinyl-
- Tetraethenylsilane
- Tetraethylenesilicon
- Tetravinylsilane
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Tetravinylsilane REF: 54-OR1015230CAS: 1112-55-6 | 97% | 32.00 €~312.00 € | Fri 28 Mar 25 |
 | Tetravinylsilane REF: 3B-T4058CAS: 1112-55-6 | >97.0%(GC) | 122.00 €~407.00 € | Tue 01 Apr 25 |
 | Tetravinylsilane REF: 10-S16475CAS: 1112-55-6 | 97% | To inquire | Tue 08 Apr 25 |
 | TETRAVINYLSILANE, 95% REF: 3H-SIT7897.0CAS: 1112-55-6 | 95% | - - - | Discontinued product |
 | Tetravinylsilane REF: 3D-FT153133CAS: 1112-55-6 | Min. 95% | - - - | Discontinued product |
Ref: 54-OR1015230
| 5g | 32.00 € | ||
| 25g | 98.00 € | ||
| 100g | 312.00 € |
Tetravinylsilane
Ref: 3B-T4058
| 5ml | 122.00 € | ||
| 25ml | 407.00 € |
Tetravinylsilane
Ref: 10-S16475
| 1g | To inquire | ||
| 5g | To inquire | ||
| 25g | To inquire |
TETRAVINYLSILANE, 95%
Ref: 3H-SIT7897.0
| 10g | Discontinued | Request information | |
| 50g | Discontinued | Request information |
Tetravinylsilane
Ref: 3D-FT153133
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information | |
| 100g | Discontinued | Request information | |
| 250g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
