CAS 1113049-91-4: 6-Chloro-5-(trifluoromethyl)-3-pyridinemethanol
Description:6-Chloro-5-(trifluoromethyl)-3-pyridinemethanol is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 6-position and a trifluoromethyl group at the 5-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The hydroxymethyl group at the 3-position enhances its reactivity, making it a candidate for various chemical transformations. This compound is often studied for its potential applications in pharmaceuticals, agrochemicals, and materials science due to its ability to interact with biological targets or serve as a building block in synthetic pathways. Its molecular structure suggests that it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. As with many halogenated compounds, considerations regarding its environmental impact and safety profile are essential in its handling and application.
Formula:C7H5ClF3NO
InChI:InChI=1S/C7H5ClF3NO/c8-6-5(7(9,10)11)1-4(3-13)2-12-6/h1-2,13H,3H2
InChI key:InChIKey=YIHKAUGXYSEKCW-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=CC(=CN=C1Cl)CO
- Synonyms:
- (6-Chloro-5-(Trifluoromethyl)Pyridin-3-Yl)Methanol
- 2-Chloro-3-(trifluoromethyl)-5-hydroxymethylpyridine
- 3-Pyridinemethanol, 6-chloro-5-(trifluoromethyl)-
- 6-Chloro-5-(trifluoromethyl)-3-pyridinemethanol

(6-Chloro-5-(trifluoromethyl)pyridin-3-yl)methanol
Ref: IN-DA0082IX
1g | 283.00 € | ||
100mg | 118.00 € | ||
250mg | 175.00 € |

(6-Chloro-5-(trifluoromethyl)pyridin-3-yl)methanol
Ref: 54-PC101976
1g | 762.00 € | ||
250mg | 244.00 € |

(6-Chloro-5-(trifluoromethyl)pyridin-3-yl)methanol
Ref: 10-F231686
1g | 255.00 € | ||
100mg | 109.00 € | ||
250mg | 131.00 € |

(6-Chloro-5-(trifluoromethyl)pyridin-3-yl)methanol
Ref: 3D-FC141368
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |