CAS 1114-41-6: Muramic acid
Description:Muramic acid, with the CAS number 1114-41-6, is a unique amino sugar that plays a significant role in the structure of bacterial cell walls, particularly in peptidoglycan. It is characterized by its molecular structure, which includes a hexose sugar backbone with an amino group and a carboxylic acid functional group. This compound is typically found in the cell walls of Gram-positive bacteria, contributing to their rigidity and structural integrity. Muramic acid is also involved in various biochemical processes, including the synthesis of peptidoglycan, which is essential for bacterial growth and survival. Its presence is a key distinguishing feature of bacterial cells compared to eukaryotic cells, which do not contain peptidoglycan. Additionally, muramic acid can be utilized in research and industrial applications, particularly in the study of bacterial physiology and the development of antibiotics targeting bacterial cell wall synthesis. Overall, muramic acid is an important compound in microbiology and biochemistry, reflecting the complexity of bacterial cell wall architecture.
Formula:C9H17NO7
InChI:InChI=1S/C9H17NO7/c1-4(9(15)16)17-8(5(10)2-11)7(14)6(13)3-12/h2,4-8,12-14H,3,10H2,1H3,(H,15,16)/t4-,5+,6-,7-,8-/m1/s1
InChI key:InChIKey=ZZHZYDXMAKUKNS-OZRXBMAMSA-N
SMILES:O=CC(N)C(OC(C(=O)O)C)C(O)C(O)CO
- Synonyms:
- (R)-2-Amino-3-O-(1-carboxyethyl)-2-deoxy-<span class="text-smallcaps">D</span>-glucose
- 2-Amino-3-O-(<span class="text-smallcaps">D</smallcap>-1-carboxyethyl)-2-deoxy-<smallcap>D</span>-glucose
- 2-Aminomuramic acid
- 2-amino-3-O-[(1R)-1-carboxyethyl]-2-deoxy-D-glucopyranose
- 2-amino-3-O-[(1R)-1-carboxyethyl]-2-deoxy-D-glucose
- 2-amino-3-O-[(1R)-1-carboxyethyl]-2-deoxy-beta-D-glucopyranose
- <span class="text-smallcaps">D</smallcap>-Glucose, 2-amino-3-O-(<smallcap>D</span>-1-carboxyethyl)-2-deoxy-
- <span class="text-smallcaps">D</span>-Glucose, 2-amino-3-O-(1-carboxyethyl)-2-deoxy-, (R)-
- Muramic acid
- D-Glucose, 2-amino-3-O-(1-carboxyethyl)-2-deoxy-, (R)-
- See more synonyms
- 2-Amino-3-O-(D-1-carboxyethyl)-2-deoxy-D-glucose
- (R)-2-Amino-3-O-(1-carboxyethyl)-2-deoxy-D-glucose
- D-Glucose, 2-amino-3-O-(D-1-carboxyethyl)-2-deoxy-
