CAS 111549-97-4: 5-O-Allyl-2,3,4-tri-O-benzyl-D-ribitol
Description:5-O-Allyl-2,3,4-tri-O-benzyl-D-ribitol is a chemical compound characterized by its complex structure, which includes a ribitol backbone modified with allyl and benzyl groups. The presence of the allyl group introduces a degree of unsaturation, making it reactive and potentially useful in various organic synthesis applications. The tri-O-benzyl substitutions enhance the lipophilicity of the molecule, which can influence its solubility and reactivity in organic solvents. This compound is typically utilized in synthetic organic chemistry, particularly in the synthesis of glycosides or as an intermediate in the preparation of more complex molecules. Its structure suggests potential applications in medicinal chemistry and biochemistry, where modifications of sugar alcohols can lead to biologically active compounds. The specific stereochemistry and functional groups present in 5-O-Allyl-2,3,4-tri-O-benzyl-D-ribitol contribute to its unique chemical properties, making it a valuable compound for research and development in various chemical fields.
Formula:C29H34O5
InChI:InChI=1/C29H34O5/c1-2-18-31-23-28(33-21-25-14-8-4-9-15-25)29(34-22-26-16-10-5-11-17-26)27(19-30)32-20-24-12-6-3-7-13-24/h2-17,27-30H,1,18-23H2/t27-,28+,29-/m0/s1
- Synonyms:
- 2,3,4-Tris-O-(phenylmethyl)-5-O-2-propenyl-D-ribitol
- 2,3,4-tri-O-benzyl-5-O-prop-2-en-1-yl-D-ribitol
- 5-O-Allyl-2,3,4-O-benzyl-D-ribitol

5-O-Allyl-2,3,4-tri-O-benzyl-D-ribitol
Ref: 3D-W-200830
9.5kg | To inquire |

(2S,3S,4R)-5-(Allyloxy)-2,3,4-tris(benzyloxy)pentan-1-ol
Ref: IN-DA007ADF
1g | 203.00 € | ||
250mg | 157.00 € |

5-O-Allyl-2,3,4-tri-O-benzyl-D-ribitol
Ref: 3D-MA03947
2g | 254.00 € | ||
5g | 423.00 € | ||
10g | 627.00 € | ||
25g | 1,081.00 € | ||
50g | 1,901.00 € |