CAS 111853-51-1: 3,5-Bis-methoxymethyl-1,2,4-triazol-4-ylamine

Description:3,5-Bis-methoxymethyl-1,2,4-triazol-4-ylamine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features two methoxymethyl groups attached to the 3 and 5 positions of the triazole ring, enhancing its solubility and reactivity. The presence of the amino group at the 4 position contributes to its potential as a ligand in coordination chemistry and its utility in various biological applications. The methoxymethyl substituents can influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. This compound may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical research. Its specific reactivity and applications can vary based on the functional groups present and the overall molecular structure. As with many triazole derivatives, it may also participate in hydrogen bonding and other intermolecular interactions, which can be crucial for its biological activity and efficacy in various formulations.

Formula:C₆H₁₂N₄O₂

InChI:InChI=1/C6H12N4O2/c1-11-3-5-8-9-6(4-12-2)10(5)7/h3-4,7H2,1-2H3