CAS 1119452-30-0: 2-[(Hexahydro-1H-azepin-1-yl)methyl]-4-methoxybenzaldehyde

Description: 2-[(Hexahydro-1H-azepin-1-yl)methyl]-4-methoxybenzaldehyde is an organic compound characterized by its unique structure, which includes a methoxy group and an aldehyde functional group attached to a benzene ring. The presence of the hexahydro-1H-azepin moiety introduces a cyclic amine component, contributing to its potential biological activity. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the azepine ring can influence receptor interactions and biological pathways. Additionally, the aldehyde group may participate in various chemical reactions, such as condensation or reduction, making it a versatile intermediate in organic synthesis. The compound's stability, solubility, and reactivity would depend on the specific conditions and solvents used in experiments. Overall, 2-[(Hexahydro-1H-azepin-1-yl)methyl]-4-methoxybenzaldehyde represents a complex organic molecule with potential implications in various chemical and pharmaceutical applications.

Formula: C₁₅H₂₁NO₂

InChI: InChI=1S/C15H21NO2/c1-18-15-7-6-13(12-17)14(10-15)11-16-8-4-2-3-5-9-16/h6-7,10,12H,2-5,8-9,11H2,1H3

InChI key: InChIKey=DJHCBWIPUKKNTQ-UHFFFAOYSA-N

SMILES: O=CC1=CC=C(OC)C=C1CN2CCCCCC2

Synonyms:

• 2-[(Hexahydro-1H-azepin-1-yl)methyl]-4-methoxybenzaldehyde
• Benzaldehyde, 2-[(hexahydro-1H-azepin-1-yl)methyl]-4-methoxy-

2-(azepan-1-ylmethyl)-4-methoxybenzaldehyde

CAS: 1119452-30-0

• Molecular weight: 247.33799743652344

2-(Azepan-1-ylmethyl)-4-methoxybenzaldehyde

CAS: 1119452-30-0

Please enquire for more information about 2-(Azepan-1-ylmethyl)-4-methoxybenzaldehyde including the price, delivery time and more detailed …

• Formula: C₁₅H₂₁NO₂
• Purity: Min. 95%
• Molecular weight: 247.33 g/mol