CAS 1119452-97-9: 3-(4-Ethoxy-2-methoxyphenyl)-2-propenoic acid
Description:3-(4-Ethoxy-2-methoxyphenyl)-2-propenoic acid, identified by its CAS number 1119452-97-9, is an organic compound characterized by its propenoic acid structure, which features a conjugated double bond system. This compound contains a phenyl ring substituted with both ethoxy and methoxy groups, contributing to its unique chemical properties and potential reactivity. The presence of these substituents can influence the compound's solubility, polarity, and overall stability. Typically, compounds of this nature may exhibit interesting biological activities, making them of interest in pharmaceutical and materials science research. The propenoic acid moiety suggests potential for polymerization or other chemical transformations, which could be leveraged in synthetic applications. Additionally, the compound's functional groups may participate in various chemical reactions, such as esterification or amidation, further expanding its utility in organic synthesis. Overall, 3-(4-Ethoxy-2-methoxyphenyl)-2-propenoic acid represents a versatile structure with potential applications in diverse fields.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-3-16-10-6-4-9(5-7-12(13)14)11(8-10)15-2/h4-8H,3H2,1-2H3,(H,13,14)
InChI key:InChIKey=VCIIWZZZNHYZFT-UHFFFAOYSA-N
SMILES:O=C(O)C=CC1=CC=C(OCC)C=C1OC
- Synonyms:
- 3-(4-Ethoxy-2-methoxyphenyl)-2-propenoic acid
- 2-Propenoic acid, 3-(4-ethoxy-2-methoxyphenyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (2E)-3-(4-ethoxy-2-methoxyphenyl)acrylic acid REF: 10-F366953CAS: 1119452-97-9 | - - - | - - - | Discontinued product |
![]() | (2E)-3-(4-Ethoxy-2-methoxyphenyl)acrylic acid REF: 3D-FE117816CAS: 1119452-97-9 | Min. 95% | - - - | Discontinued product |

Ref: 10-F366953
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

(2E)-3-(4-Ethoxy-2-methoxyphenyl)acrylic acid
Ref: 3D-FE117816
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |