CAS 1123-24-6: 1-methylcyclohexanecarboxamide
Description:1-Methylcyclohexanecarboxamide, with the CAS number 1123-24-6, is an organic compound characterized by its amide functional group attached to a cyclohexane ring that has a methyl substituent. This compound features a cyclohexane backbone, which contributes to its cyclic structure and influences its physical properties, such as boiling and melting points. The presence of the carboxamide group (-C(=O)NH2) imparts polar characteristics, enhancing its solubility in polar solvents like water and alcohols. The methyl group adds to the steric bulk and can affect the compound's reactivity and interaction with other molecules. Typically, amides exhibit moderate to high boiling points due to hydrogen bonding capabilities. 1-Methylcyclohexanecarboxamide may be utilized in various applications, including organic synthesis and as a potential intermediate in the production of pharmaceuticals or agrochemicals. Its specific reactivity and applications would depend on the functional groups present and the overall molecular structure.
Formula:C8H15NO
InChI:InChI=1/C8H15NO/c1-8(7(9)10)5-3-2-4-6-8/h2-6H2,1H3,(H2,9,10)
- Synonyms:
- Cyclohexanecarboxamide, 1-methyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Methylcyclohexane-1-carboxamide REF: 3D-BAA12324CAS: 1123-24-6 | Min. 95% | 185.00 €~1,652.00 € | Thu 08 May 25 |
![]() | 1-Methylcyclohexane-1-carboxamide REF: 10-F655165CAS: 1123-24-6 | 95+% | - - - | Discontinued product |

1-Methylcyclohexane-1-carboxamide
Ref: 3D-BAA12324
50mg | 473.00 € | ||
500mg | 1,280.00 € |

Ref: 10-F655165
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |