CAS 112538-88-2: methyl 3-hydroxypentadecanoate
Description:Methyl 3-hydroxypentadecanoate is an ester derived from pentadecanoic acid, characterized by the presence of a hydroxyl group at the third carbon position of the pentadecanoic chain. This compound typically appears as a colorless to pale yellow liquid with a fatty odor, reflecting its long-chain fatty acid structure. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the hydroxyl group imparts some polar characteristics, which can influence its reactivity and interactions with other molecules. Methyl 3-hydroxypentadecanoate is of interest in various fields, including biochemistry and materials science, due to its potential applications in the synthesis of surfactants, emulsifiers, and other functional materials. Additionally, it may play a role in biological systems, particularly in lipid metabolism and cellular signaling pathways. As with many esters, it may undergo hydrolysis under certain conditions, reverting to its constituent acid and alcohol.
Formula:C16H32O3
InChI:InChI=1/C16H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-15(17)14-16(18)19-2/h15,17H,3-14H2,1-2H3
- Synonyms:
- Pentadecanoic Acid, 3-Hydroxy-, Methyl Ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Methyl 3-Hydroxypentadecanoate REF: 48-24-1503CAS: 112538-88-2 | >98% | To inquire | Mon 31 Mar 25 |
![]() | Methyl 3-hydroxypentadecanoate REF: 3D-MEA53888CAS: 112538-88-2 | Min. 95% | - - - | Discontinued product |

Methyl 3-Hydroxypentadecanoate
Ref: 48-24-1503
25mg | 248.00 € | ||
50mg | To inquire |

Methyl 3-hydroxypentadecanoate
Ref: 3D-MEA53888
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |