CAS 112575-13-0: 6-Bromo-N,N-dimethyl-2-pyridinamine

Description:6-Bromo-N,N-dimethyl-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions, such as electrophilic substitution. The dimethylamino group at the 2-position enhances its basicity and solubility in polar solvents, making it useful in synthetic organic chemistry. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its properties, including melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, 6-Bromo-N,N-dimethyl-2-pyridinamine may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, highlighting its significance in medicinal chemistry and material science. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.

Formula:C₇H₉BrN₂

InChI:InChI=1S/C7H9BrN2/c1-10(2)7-5-3-4-6(8)9-7/h3-5H,1-2H3

InChI key:InChIKey=MIOQBSPUPLFYHC-UHFFFAOYSA-N

SMILES:BrC=1N=C(C=CC1)N(C)C

Synonyms:
(6-Bromopyridin-2-yl)dimethylamine
2-Bromo-6-(dimethylamino)pyridine
6-Bromo-N,N-dimethyl-2-pyridinamine
2-Pyridinamine, 6-bromo-N,N-dimethyl-
6-Bromo-2-(dimethylamino)pyridine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
6-Bromo-N,N-dimethylpyridin-2-amine REF: IN-DA00826OCAS: 112575-13-0	98%	To inquire	Tue 04 Mar 25
6-Bromo-N,N-dimethylpyridin-2-amine REF: 10-F210434CAS: 112575-13-0	95.0%	86.00 €~532.00 €	Wed 05 Mar 25
6-Bromo-2-N,N-dimethylaminopyridine REF: 54-OR909817CAS: 112575-13-0	By hplc: 98.4% (Typical Value in Batch COA)	71.00 €~1,263.00 €	Tue 11 Mar 25
6-Bromo-N,N-dimethylpyridin-2-amine REF: 3D-FB155886CAS: 112575-13-0	Min. 95%	- - -	Discontinued product