CAS 112575-84-5: 4-Pyrrol-1-ylbenzoic acid hydrazide
Description:4-Pyrrol-1-ylbenzoic acid hydrazide is an organic compound characterized by its hydrazide functional group attached to a benzoic acid moiety, with a pyrrole ring contributing to its structure. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of both hydrophilic (carboxylic acid and hydrazide) and hydrophobic (aromatic and pyrrole) components. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. The presence of the pyrrole ring can influence its reactivity and interaction with biological targets. Additionally, the compound may undergo various chemical reactions, including hydrazone formation and coupling reactions, which are common for hydrazides. Its stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 4-Pyrrol-1-ylbenzoic acid hydrazide is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C11H11N3O
InChI:InChI=1S/C11H11N3O/c12-13-11(15)9-3-5-10(6-4-9)14-7-1-2-8-14/h1-8H,12H2,(H,13,15)
InChI key:InChIKey=GPXSNEVNUORJCZ-UHFFFAOYSA-N
SMILES:O=C(NN)C1=CC=C(C=C1)N2C=CC=C2
- Synonyms:
- 4-(1H-Pyrrol-1-yl)benzoic acid hydrazide
- 4-Pyrrol-1-ylbenzoic acid hydrazide
- benzoic acid, 4-(1H-pyrrol-1-yl)-, hydrazide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(1H-PYRROL-1-YL)BENZOHYDRAZIDE REF: IN-DA008VGICAS: 112575-84-5 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 4-(1H-Pyrrol-1-yl)benzohydrazide REF: 10-F061345CAS: 112575-84-5 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 4-(1H-Pyrrol-1-yl)benzohydrazide REF: 3D-FP114288CAS: 112575-84-5 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA008VGI
Undefined size | To inquire |

Ref: 10-F061345
1g | To inquire | ||
5g | To inquire |

4-(1H-Pyrrol-1-yl)benzohydrazide
Ref: 3D-FP114288
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |