CAS 112726-66-6: BTCP
Description:BTCP, or 1-benzyl-3-(1,2,3,4-tetrahydroisoquinolin-2-yl)urea, is a chemical compound characterized by its unique molecular structure, which includes a benzyl group and a tetrahydroisoquinoline moiety. This compound is primarily recognized for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. BTCP exhibits properties that may influence its solubility, stability, and reactivity, making it of interest in drug design and synthesis. Its specific interactions with biological targets can lead to various pharmacological effects, which are often explored in research settings. Additionally, BTCP's chemical stability and reactivity can be influenced by factors such as pH and temperature, which are critical in determining its behavior in biological systems. As with many compounds, safety and handling precautions are essential due to potential toxicity or reactivity, necessitating thorough investigation in laboratory settings. Overall, BTCP represents a significant area of study within the field of organic and medicinal chemistry.
Formula:C19H25NS
InChI:InChI=1S/C19H25NS/c1-5-11-19(12-6-1,20-13-7-2-8-14-20)18-15-16-9-3-4-10-17(16)21-18/h3-4,9-10,15H,1-2,5-8,11-14H2
InChI key:InChIKey=RGSVXQJPSWZXOP-UHFFFAOYSA-N
SMILES:S1C=2C=CC=CC2C=C1C3(N4CCCCC4)CCCCC3
- Synonyms:
- 1-(1-(2-Benzo(b)thienyl)cyclohexyl)piperidine
- 1-(1-Benzo(b)thien-2-ylcyclohexyl)piperidine
- 1-Btcp
- 1-[1-(1-Benzothiophen-2-Yl)Cyclohexyl]Piperidine
- 1-[1-(1-Benzothiophen-2-Yl)Cyclohexyl]Piperidine Hydrochloride (1:1)
- 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine (2Z)-but-2-enedioate (1:1)
- Benocyclidine
- Btcp
- Btcp Hcl
- Gk 13
- See more synonyms
- N-(1-(2-Benzo(b)thiophenyl)cyclohexyl)piperidine
- Piperidine, 1-(1-benzo(b)thien-2-ylcyclohexyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | BTCP hydrochloride REF: 7W-GK0099CAS: 112726-66-6 | ≥ 98% | To inquire | Mon 03 Mar 25 |
![]() | Benocyclidine-d10 REF: 3D-MEA72666CAS: 112726-66-6 | Min. 95% | To inquire | Tue 15 Apr 25 |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
BTCP hydrochloride
Ref: 7W-GK0099
Undefined size | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Benocyclidine-d10
Controlled ProductRef: 3D-MEA72666
50mg | 1,061.00 € | ||
100mg | 1,388.00 € |