CAS 1129540-92-6: 3-Bromo-5-(4-morpholinyl)benzonitrile
Description:3-Bromo-5-(4-morpholinyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a morpholine group attached to a benzonitrile moiety. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. The morpholine group, a six-membered ring containing both oxygen and nitrogen, contributes to the compound's potential biological activity and solubility in polar solvents. This compound is typically used in medicinal chemistry and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the compound's reactivity can be influenced by the electron-withdrawing nature of the nitrile group and the electron-donating characteristics of the morpholine, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H11BrN2O
InChI:InChI=1S/C11H11BrN2O/c12-10-5-9(8-13)6-11(7-10)14-1-3-15-4-2-14/h5-7H,1-4H2
InChI key:InChIKey=HRTGYUCAEDJNMR-UHFFFAOYSA-N
SMILES:N#CC1=CC(Br)=CC(=C1)N2CCOCC2
- Synonyms:
- 3-Bromo-5-(4-morpholinyl)benzonitrile
- Benzonitrile, 3-bromo-5-(4-morpholinyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Bromo-5-morpholinobenzonitrile REF: IN-DA00HCGFCAS: 1129540-92-6 | 97% | To inquire | Thu 27 Mar 25 |
![]() | N-(3-BROMO-5-CYANO-PHENYL)-MORPHOLINE REF: 10-F301033CAS: 1129540-92-6 | 97.0% | - - - | Discontinued product |
![]() | N-(3-Bromo-5-cyano-phenyl)-morpholine REF: 3D-EVB54092CAS: 1129540-92-6 | Min. 95% | - - - | Discontinued product |

3-Bromo-5-morpholinobenzonitrile
Ref: IN-DA00HCGF
1g | 531.00 € | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | 205.00 € | ||
250mg | 264.00 € | ||
500mg | 300.00 € |

Ref: 10-F301033
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information |

N-(3-Bromo-5-cyano-phenyl)-morpholine
Ref: 3D-EVB54092
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |