CAS 113053-50-2: Methyl 1,2,3-benzotriazole-5-carboxylate
Description:Methyl 1,2,3-benzotriazole-5-carboxylate is an organic compound characterized by its benzotriazole structure, which consists of a fused triazole and benzene ring. This compound features a carboxylate functional group, contributing to its potential as a ligand in coordination chemistry and its applications in various fields, including agriculture and materials science. It is typically a white to off-white solid, soluble in organic solvents, and exhibits moderate stability under standard conditions. The presence of the methyl ester group enhances its reactivity and solubility, making it useful in synthetic organic chemistry. Additionally, benzotriazole derivatives are known for their UV-absorbing properties, which can be beneficial in protecting materials from photodegradation. The compound may also exhibit biological activity, although specific interactions and mechanisms would require further investigation. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or environmental impact.
Formula:C8H7N3O2
InChI:InChI=1/C8H7N3O2/c1-13-8(12)5-2-3-6-7(4-5)10-11-9-6/h2-4H,1H3,(H,9,10,11)
- Synonyms:
- Methyl 1H-1,2,3-benzotriazole-5-carboxylate
- methyl 2H-benzotriazole-5-carboxylate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Methyl 1H-benzo[d][1,2,3]triazole-6-carboxylate REF: IN-DA007RG4CAS: 113053-50-2 | 98% | To inquire | Thu 27 Mar 25 |
 | Methyl 1H-1,2,3-benzotriazole-5-carboxylate REF: 54-OR26811CAS: 113053-50-2 | 98% | 194.00 €~506.00 € | Thu 03 Apr 25 |
 | Methyl-1,2,3-benzotriazole-5-carboxylate REF: 10-F038574CAS: 113053-50-2 | 95.0% | To inquire | Tue 08 Apr 25 |
 | 1H-Benzotriazole-5-carboxylic acid methylester REF: 3D-FB151905CAS: 113053-50-2 | Min. 95% | - - - | Discontinued product |
![Methyl 1H-benzo[d][1,2,3]triazole-6-carboxylate](https://static.cymitquimica.com/products/IN/thumb/DA007RG4.jpg)
Methyl 1H-benzo[d][1,2,3]triazole-6-carboxylate
Ref: IN-DA007RG4
| 1g | 110.00 € | ||
| 5g | 212.00 € | ||
| 10g | 499.00 € | ||
| 25g | To inquire | ||
| 100mg | 44.00 € | ||
| 250mg | 59.00 € |
Methyl 1H-1,2,3-benzotriazole-5-carboxylate
Ref: 54-OR26811
| 5g | 194.00 € | ||
| 25g | 506.00 € |
Methyl-1,2,3-benzotriazole-5-carboxylate
Ref: 10-F038574
| 1g | 91.00 € | ||
| 5g | 110.00 € | ||
| 10g | 210.00 € | ||
| 25g | 482.00 € |
1H-Benzotriazole-5-carboxylic acid methylester
Ref: 3D-FB151905
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
