CAS 1133-49-9: 1-CHLOROMETHYL-2,3,4-TRIMETHOXYBENZENE
Description:1-Chloromethyl-2,3,4-trimethoxybenzene, with the CAS number 1133-49-9, is an organic compound characterized by its aromatic structure and the presence of multiple methoxy groups. This compound features a benzene ring substituted with three methoxy (-OCH3) groups at the 2, 3, and 4 positions, along with a chloromethyl (-CH2Cl) group at the 1 position. The presence of these functional groups contributes to its chemical reactivity and potential applications in organic synthesis. The methoxy groups enhance the electron density of the aromatic ring, influencing its reactivity in electrophilic aromatic substitution reactions. Additionally, the chloromethyl group can serve as a reactive site for further chemical transformations, making this compound useful in the synthesis of more complex organic molecules. Its physical properties, such as solubility and boiling point, are influenced by the methoxy groups and the chloromethyl substituent, which can affect its behavior in various chemical environments. Overall, this compound is of interest in both synthetic organic chemistry and potential applications in pharmaceuticals or materials science.
Formula:C10H13ClO3
InChI:InChI=1/C10H13ClO3/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5H,6H2,1-3H3
- Synonyms:
- Toluene, alpha-chloro-2,3,4-trimethoxy-
- alpha-Chloro-2,3,4-trimethoxytoluene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzene,1-(chloromethyl)-2,3,4-trimethoxy- REF: IN-DA007SKZCAS: 1133-49-9 | 96% | To inquire | Thu 27 Mar 25 |
![]() | Trimetazidine Impurity 11 REF: 4Z-T-3527CAS: 1133-49-9 | - - - | To inquire | Thu 03 Apr 25 |
![]() | 2,3,4-Trimethoxybenzyl Chloride REF: TR-T798060CAS: 1133-49-9 | - - - | 1,568.00 € | Wed 07 May 25 |
![]() | 2,3,4-Trimethoxybenzyl Chloride REF: 3D-BAA13349CAS: 1133-49-9 | Min. 95% | - - - | Discontinued product |

Benzene,1-(chloromethyl)-2,3,4-trimethoxy-
Ref: IN-DA007SKZ
1g | To inquire | ||
250mg | To inquire |

Ref: 4Z-T-3527
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

2,3,4-Trimethoxybenzyl Chloride
Controlled ProductRef: TR-T798060
2500mg | 1,568.00 € |

2,3,4-Trimethoxybenzyl Chloride
Ref: 3D-BAA13349
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |