CAS 1133115-80-6: 2-(6-Bromo-2-naphthalenyl)-5-methyl-1,3,4-oxadiazole

Description:2-(6-Bromo-2-naphthalenyl)-5-methyl-1,3,4-oxadiazole is a chemical compound characterized by its unique structure, which includes a naphthalene moiety substituted with a bromine atom and an oxadiazole ring. The presence of the oxadiazole group contributes to its potential as a heterocyclic compound, often associated with various biological activities and applications in materials science. This compound typically exhibits properties such as fluorescence, making it of interest in organic electronics and photonic applications. The bromine substitution can enhance its reactivity and solubility in organic solvents, which is beneficial for synthetic processes. Additionally, the methyl group at the 5-position of the oxadiazole ring can influence its electronic properties and stability. Overall, this compound's structural features suggest potential utility in fields such as medicinal chemistry, where derivatives of oxadiazoles are explored for their pharmacological properties, as well as in the development of advanced materials.

Formula:C₁₃H₉BrN₂O

InChI:InChI=1S/C13H9BrN2O/c1-8-15-16-13(17-8)11-3-2-10-7-12(14)5-4-9(10)6-11/h2-7H,1H3

InChI key:InChIKey=AHEAYMGVAUKTMZ-UHFFFAOYSA-N

SMILES:BrC=1C=CC=2C=C(C=CC2C1)C3=NN=C(O3)C

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-(6-Bromonaphthalen-2-yl)-5-methyl-1,3,4-oxadiazole REF: IN-DA007SM7CAS: 1133115-80-6	- - -	To inquire	Tue 04 Mar 25
2-(6-Bromonaphthalen-2-yl)-5-methyl-1,3,4-oxadiazole REF: 10-F212902CAS: 1133115-80-6	95.0%	- - -	Discontinued product
2-(6-Bromonaphthalen-2-yl)-5-methyl-1,3,4-oxadiazole REF: 3D-IVB11580CAS: 1133115-80-6	Min. 95%	- - -	Discontinued product