CAS 1133116-19-4: 3-(4-Bromophenyl)-5-(dichloromethyl)-1,2,4-oxadiazole
Description:3-(4-Bromophenyl)-5-(dichloromethyl)-1,2,4-oxadiazole is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. The presence of the 4-bromophenyl group contributes to its aromatic properties and potential reactivity, while the dichloromethyl substituent enhances its electrophilic character. This compound is typically synthesized through methods involving the reaction of appropriate precursors, often under controlled conditions to ensure the stability of the oxadiazole structure. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs or agrochemicals. The compound's physical properties, such as solubility and melting point, can vary based on its molecular interactions and the presence of substituents. Additionally, its chemical behavior can be influenced by the bromine and dichloromethyl groups, which may participate in further reactions or interactions with other molecules. Overall, 3-(4-Bromophenyl)-5-(dichloromethyl)-1,2,4-oxadiazole represents a class of compounds with diverse applications in chemistry and materials science.
Formula:C9H5BrCl2N2O
InChI:InChI=1S/C9H5BrCl2N2O/c10-6-3-1-5(2-4-6)8-13-9(7(11)12)15-14-8/h1-4,7H
InChI key:InChIKey=KKRHIWCBMSLHCV-UHFFFAOYSA-N
SMILES:ClC(Cl)C1=NC(=NO1)C=2C=CC(Br)=CC2
- Synonyms:
- 1,2,4-Oxadiazole, 3-(4-bromophenyl)-5-(dichloromethyl)-
- 3-(4-Bromophenyl)-5-(dichloromethyl)-1,2,4-oxadiazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(4-Bromophenyl)-5-(dichloromethyl)-1,2,4-oxadiazole REF: IN-DA003I3HCAS: 1133116-19-4 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 3-(4-Bromophenyl)-5-(dichloromethyl)-1,2,4-oxadiazole REF: 10-F213219CAS: 1133116-19-4 | 95.0% | - - - | Discontinued product |
![]() | 3-(4-Bromophenyl)-5-(dichloromethyl)-1,2,4-oxadiazole REF: 3D-IVB11619CAS: 1133116-19-4 | Min. 95% | - - - | Discontinued product |

3-(4-Bromophenyl)-5-(dichloromethyl)-1,2,4-oxadiazole
Ref: IN-DA003I3H
Undefined size | To inquire |

3-(4-Bromophenyl)-5-(dichloromethyl)-1,2,4-oxadiazole
Ref: 10-F213219
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
25g | Discontinued | Request information |

3-(4-Bromophenyl)-5-(dichloromethyl)-1,2,4-oxadiazole
Ref: 3D-IVB11619
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
500mg | Discontinued | Request information |