CAS 113544-59-5: 2,3,4,6-TETRA-O-BENZOYL-D-MANNOPYRANOSE
Description:2,3,4,6-Tetra-O-benzoyl-D-mannopyranose is a derivative of D-mannose, a naturally occurring sugar. This compound features four benzoyl groups attached to the hydroxyl positions of the mannopyranose ring, which enhances its lipophilicity and stability compared to the parent sugar. The presence of these benzoyl groups not only influences its solubility in organic solvents but also affects its reactivity in various chemical reactions, making it useful in synthetic organic chemistry. The compound typically appears as a white to off-white crystalline solid and is often utilized as an intermediate in the synthesis of more complex carbohydrates or glycosides. Its structure allows for potential applications in medicinal chemistry and biochemistry, particularly in the study of carbohydrate interactions and modifications. Additionally, the compound's CAS number, 113544-59-5, serves as a unique identifier for regulatory and safety information. As with many chemical substances, proper handling and storage conditions are essential to maintain its integrity and ensure safety during use.
Formula:C34H28O10
InChI:InChI=1/C34H28O10/c35-30(22-13-5-1-6-14-22)40-21-26-27(42-31(36)23-15-7-2-8-16-23)28(43-32(37)24-17-9-3-10-18-24)29(34(39)41-26)44-33(38)25-19-11-4-12-20-25/h1-20,26-29,34,39H,21H2/t26-,27-,28+,29+,34u/m1/s1
- Synonyms:
- D-Mannose, 2,3,4,6-tetrabenzoate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,3,4,6-Tetra-O-benzoyl-D-mannopyranose REF: 3B-T2056CAS: 113544-59-5 | >93.0%(HPLC) | 103.00 €~318.00 € | Thu 20 Mar 25 |
![]() | D-Mannose, 2,3,4,6-tetrabenzoate REF: IN-DA0008YQCAS: 113544-59-5 | 93% | 87.00 €~554.00 € | Thu 27 Mar 25 |
![]() | 2,3,4,6-Tetra-O-benzoyl-D-mannopyranose REF: 3D-NEA54459CAS: 113544-59-5 | Min. 95% | - - - | Discontinued product |

2,3,4,6-Tetra-O-benzoyl-D-mannopyranose
Ref: 3B-T2056
1g | 103.00 € | ||
5g | 318.00 € |

D-Mannose, 2,3,4,6-tetrabenzoate
Ref: IN-DA0008YQ
1g | 196.00 € | ||
5g | 554.00 € | ||
200mg | 87.00 € |

2,3,4,6-Tetra-O-benzoyl-D-mannopyranose
Ref: 3D-NEA54459
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |