CAS 113743-17-2: 2-[(6-hydroxypyridine-3-carbonyl)amino]ethyl nitrate

Description:2-[(6-hydroxypyridine-3-carbonyl)amino]ethyl nitrate, with the CAS number 113743-17-2, is a chemical compound characterized by its unique functional groups and structural features. It contains a hydroxypyridine moiety, which contributes to its potential biological activity, and an amino group that links to an ethyl nitrate group. This structure suggests that the compound may exhibit both hydrophilic and lipophilic properties, influencing its solubility and reactivity. The presence of the nitrate group indicates potential for nitrate-related pharmacological effects, possibly involving vasodilation or other cardiovascular activities. Additionally, the hydroxypyridine component may impart chelating properties, allowing for interactions with metal ions. The compound's synthesis and stability can be influenced by environmental factors such as pH and temperature. Overall, 2-[(6-hydroxypyridine-3-carbonyl)amino]ethyl nitrate represents a complex molecule with potential applications in medicinal chemistry and pharmacology, warranting further investigation into its biological effects and mechanisms of action.

Formula:C₈H₉N₃O₅

InChI:InChI=1/C8H9N3O5/c12-7-2-1-6(5-10-7)8(13)9-3-4-16-11(14)15/h1-2,5H,3-4H2,(H,9,13)(H,10,12)

Found 6 products.

Product data	Purity	Price range	Estimated delivery
3-Pyridinecarboxamide, 1,6-dihydro-N-[2-(nitrooxy)ethyl]-6-oxo- REF: IN-DA0009JFCAS: 113743-17-2	- - -	To inquire	Mon 03 Mar 25
6-Hydroxy Nicorandil REF: 4Z-N-058CAS: 113743-17-2	- - -	To inquire	Tue 04 Mar 25
6-Hydroxy Nicorandil-d4 REF: 4Z-N-059CAS: 113743-17-2	- - -	To inquire	Mon 10 Mar 25
6-Hydroxy Nicorandil REF: TR-H948550CAS: 113743-17-2	- - -	2,353.00 €	Tue 15 Apr 25
6-Hydroxy Nicorandil-d4 REF: TR-H948552CAS: 113743-17-2	- - -	1,568.00 €	Tue 15 Apr 25
6-Hydroxy nicorandil REF: 3D-FH24063CAS: 113743-17-2	Min. 95%	- - -	Discontinued product