CAS 1142191-57-8: 2,5-Dibromo-3-methoxypyridine
Description:2,5-Dibromo-3-methoxypyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with two bromine atoms and a methoxy group. The bromine substituents are located at the 2 and 5 positions of the pyridine ring, while the methoxy group is positioned at the 3 position. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water due to its hydrophobic bromine substituents. The presence of bromine atoms contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the methoxy group can influence the electronic properties of the molecule, affecting its reactivity and interactions with other chemical species. 2,5-Dibromo-3-methoxypyridine may find applications in pharmaceuticals, agrochemicals, and materials science due to its unique structural features and reactivity.
Formula:C6H5Br2NO
InChI:InChI=1S/C6H5Br2NO/c1-10-5-2-4(7)3-9-6(5)8/h2-3H,1H3
InChI key:InChIKey=BUTXHBVASSLBPO-UHFFFAOYSA-N
SMILES:BrC1=NC=C(Br)C=C1OC
- Synonyms:
- Pyridine, 2,5-dibromo-3-methoxy-
- 2,5-Dibromo-3-methoxypyridine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,5-Dibromo-3-methoxypyridine REF: IN-DA0090PDCAS: 1142191-57-8 | 95% | To inquire | Thu 27 Mar 25 |
![]() | 2,5-Dibromo-3-methoxypyridine REF: 10-F608707CAS: 1142191-57-8 | 97% | - - - | Discontinued product |
![]() | 2,5-Dibromo-3-methoxypyridine REF: 3D-SVB19157CAS: 1142191-57-8 | Min. 95% | - - - | Discontinued product |

Ref: 10-F608707
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
250mg | Discontinued | Request information |

2,5-Dibromo-3-methoxypyridine
Ref: 3D-SVB19157
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |