CAS 1142201-78-2: 6-Hydrazinyl-3-methyl-2,4(1H,3H)-pyrimidinedione
Description:6-Hydrazinyl-3-methyl-2,4(1H,3H)-pyrimidinedione, identified by its CAS number 1142201-78-2, is a chemical compound that belongs to the class of pyrimidinediones, which are characterized by a pyrimidine ring with two carbonyl groups. This particular compound features a hydrazinyl group at the 6-position and a methyl group at the 3-position of the pyrimidine ring, contributing to its unique reactivity and potential biological activity. The presence of the hydrazinyl group suggests that it may participate in various chemical reactions, including hydrazone formation and potential redox reactions. The compound may exhibit properties such as solubility in polar solvents, and its structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential applications in pharmaceuticals or agrochemicals would depend on its specific functional groups and molecular interactions. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C5H8N4O2
InChI:InChI=1S/C5H8N4O2/c1-9-4(10)2-3(8-6)7-5(9)11/h2,8H,6H2,1H3,(H,7,11)
InChI key:InChIKey=FJTQFNMCDOXSTE-UHFFFAOYSA-N
SMILES:O=C1C=C(NN)NC(=O)N1C
- Synonyms:
- 2,4(1H,3H)-Pyrimidinedione, 6-hydrazinyl-3-methyl-
- 6-Hydrazinyl-2-hydroxy-3-methyl-3,4-dihydropyrimidin-4-one
- 6-Hydrazinyl-3-methyl-2,4(1H,3H)-pyrimidinedione

6-hydrazino-3-methylpyrimidine-2,4(1H,3H)-dione
Ref: IN-DA009QAG
1g | 491.00 € | ||
100mg | 182.00 € | ||
250mg | 218.00 € |

6-Hydrazinyl-3-methylpyrimidine-2,4(1H,3H)-dione
Ref: 54-OR77781
1g | 892.00 € | ||
5g | 2,456.00 € |

Ref: 10-F367472
1g | 466.00 € | ||
5g | 1,248.00 € | ||
100mg | 131.00 € | ||
250mg | 211.00 € |

6-Hydrazino-3-methylpyrimidine-2,4(1H,3H)-dione
Ref: 3D-FH118918
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |