CAS 114567-47-4: Ganoderiol F
Description:Ganoderiol F is a triterpenoid compound primarily derived from the Ganoderma lucidum, commonly known as reishi mushroom. This substance is characterized by its complex molecular structure, which contributes to its various biological activities. Ganoderiol F exhibits potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer effects, making it a subject of interest in medicinal chemistry and natural product research. Its mechanism of action may involve the modulation of various signaling pathways and the inhibition of specific enzymes. Additionally, Ganoderiol F is known for its low toxicity profile, which enhances its appeal for therapeutic applications. The compound is typically studied in the context of traditional medicine and modern pharmacology, highlighting its potential benefits in health and wellness. As research continues, further elucidation of its properties and mechanisms may pave the way for its use in complementary and alternative medicine.
Formula:C30H46O3
InChI:InChI=1S/C30H46O3/c1-20(8-7-9-21(18-31)19-32)22-12-16-30(6)24-10-11-25-27(2,3)26(33)14-15-28(25,4)23(24)13-17-29(22,30)5/h9-10,13,20,22,25,31-32H,7-8,11-12,14-19H2,1-6H3/t20-,22-,25+,28-,29-,30+/m1/s1
InChI key:InChIKey=JVGJXXNUVVQEIG-MCKXIFHVSA-N
SMILES:O=C1CCC2(C3=CCC4(C)C(CCC4(C3=CCC2C1(C)C)C)C(C)CCC=C(CO)CO)C
- Synonyms:
- Ganoderiol F
- Lanosta-7,9(11),24-trien-3-one, 26,27-dihydroxy-
- 26,27-Dihydroxylanosta-7,9(11),24-trien-3-one

Lanosta-7,9(11),24-trien-3-one, 26,27-dihydroxy-
Ref: IN-DA000EOP
5mg | To inquire |

Ref: BP-SBP00787
5mg | 365.00 € | ||
10mg | 606.00 € |

ganoderiol F
Controlled ProductRef: 3D-FG42654
1mg | 331.00 € | ||
5mg | 901.00 € | ||
10mg | 1,356.00 € |

Ganoderiol F
Ref: TM-TMA1012
1mg | 210.00 € | ||
5mg | 748.00 € | ||
500µg | 113.00 € |