CAS 1146299-29-7: 3-[[(Cyclopropylamino)carbonyl]amino]benzoic acid

Description: 3-[[(Cyclopropylamino)carbonyl]amino]benzoic acid, identified by its CAS number 1146299-29-7, is a chemical compound that features a benzoic acid core substituted with an amino group and a cyclopropylamino carbonyl moiety. This compound is characterized by its aromatic structure, which contributes to its potential interactions in biological systems. The presence of the cyclopropyl group introduces unique steric and electronic properties, potentially influencing its reactivity and binding affinity in various chemical and biological contexts. The carboxylic acid functional group provides acidic characteristics, allowing for protonation and deprotonation under different pH conditions. Additionally, the amino groups can participate in hydrogen bonding, enhancing solubility in polar solvents and affecting its pharmacokinetic properties. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₁₁H₁₂N₂O₃

InChI: InChI=1S/C11H12N2O3/c14-10(15)7-2-1-3-9(6-7)13-11(16)12-8-4-5-8/h1-3,6,8H,4-5H2,(H,14,15)(H2,12,13,16)

InChI key: InChIKey=GSWYSHNMCULROB-UHFFFAOYSA-N

SMILES: O=C(O)C=1C=CC=C(C1)NC(=O)NC2CC2

Synonyms:

• 3-[[(Cyclopropylamino)carbonyl]amino]benzoic acid
• Benzoic acid, 3-[[(cyclopropylamino)carbonyl]amino]-

3-[(Cyclopropylcarbamoyl)amino]benzoic acid

CAS: 1146299-29-7

Versatile small molecule scaffold

• Formula: C₁₁H₁₂N₂O₃
• Purity: Min. 95%
• Molecular weight: 220.22 g/mol

3-[(cyclopropylcarbamoyl)amino]benzoic acid

CAS: 1146299-29-7

• Purity: 95%
• Molecular weight: 220.22799682617188