CAS 114715-39-8: (R)-(-)-N-benzyl 3-aminopyrrolidine
Description:(R)-(-)-N-benzyl 3-aminopyrrolidine is a chiral organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of the benzyl group enhances its lipophilicity, potentially influencing its biological activity and interactions with various receptors. As an amine, it can participate in hydrogen bonding, making it soluble in polar solvents. The specific stereochemistry indicated by the (R)-(-) designation suggests that it exhibits optical activity, which is crucial in pharmacology, as different enantiomers can have significantly different biological effects. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system or other biological pathways. Its CAS number, 114715-39-8, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the unique structural features and stereochemistry of (R)-(-)-N-benzyl 3-aminopyrrolidine contribute to its potential applications in various fields, including drug design and synthesis.
Formula:C11H17ClN2
InChI:InChI=1/C11H16N2.ClH/c12-11-6-7-13(9-11)8-10-4-2-1-3-5-10;/h1-5,11H,6-9,12H2;1H/t11-;/m1./s1
- Synonyms:
- (R)-(-)-1-Benzyl-3-aminopyrrolidine
- (R)-(-)-3-Amino-1-benzylpyrrolidine
- 1-Benzylpyrrolidin-3-Amine
- (3R)-1-benzylpyrrolidin-3-amine hydrochloride
- 3-(R)-1-benzyl-3-aminopyrrolidine

(R)-(-)-1-Benzyl-3-aminopyrrolidine, 99%, ee 99%
Ref: 02-L19690
1g | To inquire | ||
5g | To inquire |

(3R)-(-)-1-Benzyl-3-aMinopyrrolidine
Ref: IN-DA0078BR
1g | 28.00 € | ||
5g | 66.00 € | ||
10g | 106.00 € | ||
25g | 165.00 € |

(R)-3-Amino-1-benzylpyrrolidine
Ref: 54-OR4624
250mg | 32.00 € |

(R)-3-Amino-1-N-benzyl-pyrrolidine
Ref: 10-F034295
1g | 20.00 € | ||
5g | 49.00 € | ||
10g | 93.00 € | ||
25g | 172.00 € | ||
100g | 598.00 € |

(3R)-(-)-1-Benzyl-3-aminopyrrolidine
Ref: 3B-A1173
1g | 47.00 € | ||
5g | 133.00 € |

(3R)-(-)-1-Benzyl-3-aminopyrrolidine
Ref: 3D-FB60232
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |