CAS 114715-53-6: (S)-3-AMINOTETRAHYDROFURAN-3-CARBOXYLIC ACID
Description:(S)-3-Aminotetrahydrofuran-3-carboxylic acid is a chiral compound characterized by its tetrahydrofuran ring structure, which incorporates an amino group and a carboxylic acid functional group. This compound is notable for its potential applications in medicinal chemistry, particularly in the synthesis of biologically active molecules and as a building block in the development of pharmaceuticals. The presence of the amino group allows for various chemical modifications, enhancing its reactivity and utility in organic synthesis. The stereochemistry of the compound, indicated by the (S) designation, plays a crucial role in its biological activity, as enantiomers can exhibit different pharmacological effects. Additionally, the carboxylic acid group contributes to its solubility in polar solvents and its ability to participate in acid-base reactions. Overall, (S)-3-aminotetrahydrofuran-3-carboxylic acid is a versatile compound with significant relevance in chemical research and drug development.
Formula:C5H9NO2S
InChI:InChI=1/C5H9NO2S/c6-5(4(7)8)1-2-9-3-5/h1-3,6H2,(H,7,8)/t5-/m1/s1
- Synonyms:
- 3-Thiophenecarboxylicacid,3-aminotetrahydro-,(S)-(9CI)
- (3S)-3-aminotetrahydrothiophene-3-carboxylic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-Thiophenecarboxylic acid, 3-aminotetrahydro-, (S)- (9CI) REF: IN-DA000F3QCAS: 114715-53-6 | - - - | To inquire | Mon 03 Mar 25 |
 | (S)-3-Aminotetrahydrofuran-3-carboxylicacid REF: 3D-FA151607CAS: 114715-53-6 | Min. 95% | - - - | Discontinued product |
3-Thiophenecarboxylic acid, 3-aminotetrahydro-, (S)- (9CI)
Ref: IN-DA000F3Q
| Undefined size | To inquire |
(S)-3-Aminotetrahydrofuran-3-carboxylicacid
Ref: 3D-FA151607
| 2mg | Discontinued | Request information | |
| 5mg | Discontinued | Request information | |
| 10mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information |
