CAS 1150163-80-6: Methyl 2-amino-1,2-dihydro-4-phenyl-5-pyrimidinecarboxylate
Description:Methyl 2-amino-1,2-dihydro-4-phenyl-5-pyrimidinecarboxylate, identified by its CAS number 1150163-80-6, is a chemical compound that features a pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of an amino group and a carboxylate ester, contributing to its potential as a bioactive molecule. The phenyl group attached to the pyrimidine ring enhances its lipophilicity, which may influence its pharmacokinetic properties. Methyl 2-amino-1,2-dihydro-4-phenyl-5-pyrimidinecarboxylate may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, and it may serve as a scaffold for the synthesis of more complex derivatives. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H13N3O2
InChI:InChI=1S/C12H13N3O2/c1-17-11(16)9-7-14-12(13)15-10(9)8-5-3-2-4-6-8/h2-7,12,14H,13H2,1H3
InChI key:InChIKey=LKBYBVRAJZBOJU-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CNC(N=C1C=2C=CC=CC2)N
- Synonyms:
- Methyl 2-amino-1,2-dihydro-4-phenyl-5-pyrimidinecarboxylate
- 5-Pyrimidinecarboxylic acid, 2-amino-1,2-dihydro-4-phenyl-, methyl ester
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 5-Pyrimidinecarboxylic acid, 2-amino-1,2-dihydro-4-phenyl-, methyl ester REF: IN-DA000FO5CAS: 1150163-80-6 | - - - | To inquire | Tue 04 Mar 25 |
 | Methyl 2-amino-4-phenylpyrimidine-5-carboxylate REF: 10-F211386CAS: 1150163-80-6 | 95.0% | - - - | Discontinued product |
 | Methyl 2-amino-4-phenylpyrimidine-5-carboxylate REF: 3D-AWB16380CAS: 1150163-80-6 | Min. 95% | - - - | Discontinued product |
5-Pyrimidinecarboxylic acid, 2-amino-1,2-dihydro-4-phenyl-, methyl ester
Ref: IN-DA000FO5
| Undefined size | To inquire |
Methyl 2-amino-4-phenylpyrimidine-5-carboxylate
Ref: 10-F211386
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
Methyl 2-amino-4-phenylpyrimidine-5-carboxylate
Ref: 3D-AWB16380
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information |
