CAS 1150164-14-9: Ethyl 5-amino-4-cyano-1-(3-methoxyphenyl)-1H-pyrazole-3-carboxylate
Description:Ethyl 5-amino-4-cyano-1-(3-methoxyphenyl)-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl ester group, an amino group, and a cyano group, contributing to its potential reactivity and biological activity. The presence of the 3-methoxyphenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. The compound's structure suggests it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. Its CAS number, 1150164-14-9, allows for precise identification in chemical databases. As with many pyrazole derivatives, it may possess various pharmacological activities, making it of interest in research and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in various fields, including drug discovery and agrochemicals.
Formula:C14H14N4O3
InChI:InChI=1S/C14H14N4O3/c1-3-21-14(19)12-11(8-15)13(16)18(17-12)9-5-4-6-10(7-9)20-2/h4-7H,3,16H2,1-2H3
InChI key:InChIKey=LLPZWIYSOWNJQQ-UHFFFAOYSA-N
SMILES:N#CC=1C(=NN(C=2C=CC=C(OC)C2)C1N)C(=O)OCC
- Synonyms:
- Ethyl 5-amino-4-cyano-1-(3-methoxyphenyl)-1H-pyrazole-3-carboxylate
- 1H-Pyrazole-3-carboxylic acid, 5-amino-4-cyano-1-(3-methoxyphenyl)-, ethyl ester
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1H-Pyrazole-3-carboxylic acid, 5-amino-4-cyano-1-(3-methoxyphenyl)-, ethyl ester REF: IN-DA000FNWCAS: 1150164-14-9 | - - - | To inquire | Mon 03 Mar 25 |
 | Ethyl 5-amino-4-cyano-1-(3-methoxyphenyl)pyrazole-3-carboxylate REF: 10-F638159CAS: 1150164-14-9 | 96% | - - - | Discontinued product |
 | Ethyl 5-amino-4-cyano-1-(3-methoxyphenyl)pyrazole-3-carboxylate REF: 3D-AWB16414CAS: 1150164-14-9 | Min. 95% | - - - | Discontinued product |
1H-Pyrazole-3-carboxylic acid, 5-amino-4-cyano-1-(3-methoxyphenyl)-, ethyl ester
Ref: IN-DA000FNW
| Undefined size | To inquire |
Ethyl 5-amino-4-cyano-1-(3-methoxyphenyl)pyrazole-3-carboxylate
Ref: 10-F638159
| 5g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 100g | Discontinued | Request information |
Ethyl 5-amino-4-cyano-1-(3-methoxyphenyl)pyrazole-3-carboxylate
Ref: 3D-AWB16414
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
