CAS 1150271-62-7: 2-[5-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-2,3-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:The chemical substance known as 2-[5-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-2,3-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, with the CAS number 1150271-62-7, is a boron-containing compound characterized by its complex structure, which includes a dioxaborolane ring. This compound features a difluorophenyl group and a silyl ether moiety, contributing to its unique chemical properties. The presence of the boron atom in the dioxaborolane structure suggests potential applications in organic synthesis, particularly in cross-coupling reactions, where boron compounds are often utilized as intermediates. The dimethylsilyl group enhances the compound's stability and solubility, making it suitable for various chemical reactions. Additionally, the presence of fluorine atoms can influence the compound's reactivity and polarity, potentially affecting its interactions with other molecules. Overall, this substance is of interest in the fields of organic chemistry and materials science, particularly for its potential applications in pharmaceuticals and agrochemicals.
Formula:C18H29BF2O3Si
InChI:InChI=1S/C18H29BF2O3Si/c1-16(2,3)25(8,9)22-12-10-13(15(21)14(20)11-12)19-23-17(4,5)18(6,7)24-19/h10-11H,1-9H3
InChI key:InChIKey=SYSZKZKYIDNJBD-UHFFFAOYSA-N
SMILES:FC=1C=C(O[Si](C)(C)C(C)(C)C)C=C(B2OC(C)(C)C(O2)(C)C)C1F
- Synonyms:
- 2-[5-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-2,3-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-[5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2,3-difluorophenyl]-4,4,5,5-tetramethyl-

1,3,2-Dioxaborolane, 2-[5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2,3-difluorophenyl]-4,4,5,5-tetramethyl-
Ref: IN-DA000FQQ
Undefined size | To inquire |

5-(tert-Butyldimethylsilyloxy)-2,3-difluorophenylboronic acid, pinacol ester
Ref: 54-PC412274
Undefined size | To inquire |

Tert-Butyl(3,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)dimethylsilane
Ref: 10-F696645
1g | 175.00 € | ||
5g | 466.00 € |

5-(t-ButyldiMethylsilyloxy)-2,3-difluorophenylboronic acid,
Ref: 3D-FB99597
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |