CAS 115029-24-8: 2-Fluoro-4-(trifluoromethyl)benzoic acid
Description:2-Fluoro-4-(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a trifluoromethyl group attached to a benzoic acid structure. The molecular formula of this compound is C8H4F4O2, indicating that it contains eight carbon atoms, four fluorine atoms, four hydrogen atoms, and two oxygen atoms. This compound typically exhibits a solid state at room temperature and is known for its relatively high melting point due to the strong intermolecular forces associated with the carboxylic acid functional group. The presence of multiple fluorine atoms contributes to its unique chemical properties, including increased lipophilicity and potential applications in pharmaceuticals and agrochemicals. Additionally, the fluorinated groups can enhance the compound's stability and reactivity in various chemical reactions. As with many fluorinated compounds, it may exhibit low volatility and high resistance to degradation, making it of interest in both industrial and research settings. Safety data should be consulted for handling and potential hazards associated with this substance.
Formula:C8H3F4O2
InChI:InChI=1S/C8H4F4O2/c9-6-3-4(8(10,11)12)1-2-5(6)7(13)14/h1-3H,(H,13,14)
InChI key:InChIKey=OCIYTBZXTFPSPI-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(C=C1F)C(F)(F)F
- Synonyms:
- 2-Fluoro-4-(Rifluoromethyl)Benzoic Acid
- 2-Fluoro-4-(Trifluoromethyl)Benzoate
- 2-Fluoro-4-(trifluoromethyl)benzoic acid 98%
- 2-Fluoro-4-(trifluoromethyl)benzoicacid98%
- Alpha,Alpha,Alpha,2-Tetrafluoro-P-Toluic Acid
- Benzoic acid, 2-fluoro-4-(trifluoromethyl)-
- Rarechem Al Bo 0632
- À,À,À,2-Tetrafluoro-P-Toluic Acid

Benzoic acid, 2-fluoro-4-(trifluoromethyl)-
Ref: IN-DA000FQX
1g | 29.00 € | ||
5g | 39.00 € | ||
10g | 58.00 € | ||
25g | 106.00 € | ||
100g | 246.00 € | ||
500g | To inquire |

2-Fluoro-4-(trifluoromethyl)benzoic acid
Ref: 54-PC4373
5g | 40.00 € | ||
25g | 125.00 € | ||
100g | 342.00 € |

2-Fluoro-4-(trifluoromethyl)benzoic acid
Ref: 10-F002014
1g | 20.00 € | ||
10g | 42.00 € | ||
25g | 86.00 € | ||
100g | 287.00 € | ||
500g | 1,240.00 € |

2-Fluoro-4-(trifluoromethyl)benzoic acid
Ref: 3D-FF64211
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |