CAS 115102-47-1: 5-ETHOXY-FURAN-2-CARBOXYLIC ACID
Description:5-Ethoxy-furan-2-carboxylic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. The presence of an ethoxy group (-OCH2CH3) at the 5-position of the furan ring and a carboxylic acid group (-COOH) at the 2-position contributes to its chemical reactivity and solubility properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the carboxylic acid functionality. It may exhibit moderate acidity due to the carboxylic acid group, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the furan ring can undergo electrophilic substitution reactions. The compound's unique structure may impart biological activity, making it of interest in pharmaceutical and agrochemical research. Safety data should be consulted for handling and potential hazards, as with any chemical substance.
Formula:C7H7O4
InChI:InChI=1/C7H8O4/c1-2-10-6-4-3-5(11-6)7(8)9/h3-4H,2H2,1H3,(H,8,9)/p-1
- Synonyms:
- Chembrdg-Bb 7113881
- 5-Ethoxyfuran-2-Carboxylate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-Furancarboxylic acid, 5-ethoxy- REF: IN-DA000FVYCAS: 115102-47-1 | - - - | To inquire | Tue 04 Mar 25 |
 | 5-ethoxy-2-furoic acid REF: 10-F315344CAS: 115102-47-1 | 95.0% | To inquire | Wed 12 Mar 25 |
 | 5-Ethoxyfuran-2-carboxylic acid REF: 3D-QEA10247CAS: 115102-47-1 | Min. 95% | - - - | Discontinued product |
5-ethoxy-2-furoic acid
Ref: 10-F315344
| 1g | To inquire | ||
| 250mg | To inquire |
5-Ethoxyfuran-2-carboxylic acid
Ref: 3D-QEA10247
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information | |
| 2500mg | Discontinued | Request information |
