CAS 115486-12-9: Quinoline, 2-bromo-7-methoxy-4-methyl-

Description: Quinoline, 2-bromo-7-methoxy-4-methyl- is a chemical compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This specific derivative features a bromine atom at the second position, a methoxy group (-OCH3) at the seventh position, and a methyl group (-CH3) at the fourth position of the quinoline ring. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Quinoline derivatives are known for their diverse biological activities, including antimicrobial and antimalarial properties, making them of interest in medicinal chemistry. The compound's molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the bromine substituent can serve as a useful handle for further chemical modifications, enhancing its utility in synthetic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity and environmental impact.

Formula: C₁₁H₁₀BrNO

InChI: InChI=1S/C11H10BrNO/c1-7-5-11(12)13-10-6-8(14-2)3-4-9(7)10/h3-6H,1-2H3

InChI key: InChIKey=PUMJMPPJYQXQRV-UHFFFAOYSA-N

SMILES: BrC=1N=C2C=C(OC)C=CC2=C(C1)C

Synonyms:

• 2-Bromo-7-methoxy-4-methylquinoline
• Quinoline, 2-bromo-7-methoxy-4-methyl-
• Lepidine, 2-bromo-7-methoxy-

2-Bromo-7-methoxy-4-methylquinoline

CAS: 115486-12-9

• Molecular weight: 252.11g/mol

2-Bromo-7-methoxy-4-methylquinoline

CAS: 115486-12-9

Versatile small molecule scaffold

• Formula: C₁₁H₁₀BrNO
• Purity: Min. 95%
• Molecular weight: 252.11 g/mol