
CAS 1157-33-1: 2′-Deoxy-cAMP
Description:2′-Deoxy-cAMP, also known as 2′-deoxycyclic adenosine monophosphate, is a nucleotide derivative that plays a significant role in cellular signaling. It is structurally similar to cyclic adenosine monophosphate (cAMP) but lacks the hydroxyl group at the 2′ position of the ribose sugar, which contributes to its unique properties. This modification can influence its stability and interaction with various enzymes and receptors. 2′-Deoxy-cAMP is involved in various biological processes, including the regulation of metabolic pathways and gene expression. It can act as a second messenger in signaling cascades, similar to cAMP, but its distinct structure may lead to different biological effects. The compound is often used in biochemical research to study the mechanisms of action of cyclic nucleotides and their role in cellular functions. Its CAS number, 1157-33-1, is a unique identifier that facilitates the identification and study of this specific chemical substance in scientific literature and databases.
Formula:C10H12N5O5P
InChI:InChI=1S/C10H12N5O5P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5-6(19-7)2-18-21(16,17)20-5/h3-7H,1-2H2,(H,16,17)(H2,11,12,13)/t5-,6+,7+/m0/s1
InChI key:InChIKey=MKMZAENVDZADSW-RRKCRQDMSA-N
SMILES:O=P1(O)OCC2OC(N3C=NC=4C(=NC=NC43)N)CC2O1
- Synonyms:
- Adenosine, 2′-deoxy-, cyclic 3′,5′-phosphate
- 4H-Furo[3,2-d]-1,3,2-dioxaphosphorin, adenosine deriv.
- Adenosine, 2′-deoxy-, cyclic 3′,5′-(hydrogen phosphate)
- Deoxyadenosine 3′,5′-cyclic monophosphate
- Adenosine, 2′-deoxy-, 3′,5′-phosphate (cyclic)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2'-Deoxyadenosine 3',5'-cyclic phosphate REF: 4Z-A-267035CAS: 1157-33-1 | - - - | To inquire | Thu 03 Apr 25 |

Ref: 4Z-A-267035
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |