CAS 1159823-84-3: 1H-1,4-Benzodiazepine, 9-chloro-2,3,4,5-tetrahydro-, hydrochloride (1:2)

Description:1H-1,4-Benzodiazepine, 9-chloro-2,3,4,5-tetrahydro-, hydrochloride (1:2) is a chemical compound belonging to the benzodiazepine class, which is known for its psychoactive properties. This substance features a benzodiazepine core structure, characterized by a fused benzene and diazepine ring, with a chlorine atom substituent at the 9-position. The compound is typically encountered as a hydrochloride salt, which enhances its solubility in water, making it suitable for various pharmaceutical applications. Its tetrahydro configuration indicates the presence of additional hydrogen atoms, contributing to its stability and reactivity. Benzodiazepines are primarily recognized for their anxiolytic, sedative, and muscle relaxant effects, and this specific compound may exhibit similar pharmacological activities. The presence of the hydrochloride form suggests that it may be used in formulations requiring precise dosing and stability. As with many benzodiazepines, careful handling and usage are essential due to potential side effects and the risk of dependence.

Formula:C₉H₁₁ClN₂·2ClH

InChI:InChI=1S/C9H11ClN2.2ClH/c10-8-3-1-2-7-6-11-4-5-12-9(7)8;;/h1-3,11-12H,4-6H2;2*1H

InChI key:InChIKey=JLHZTGCPIGPAHU-UHFFFAOYSA-N

SMILES:Cl.ClC1=CC=CC2=C1NCCNC2

Synonyms:
1H-1,4-Benzodiazepine, 9-chloro-2,3,4,5-tetrahydro-, hydrochloride (1:2)

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1H-1,4-Benzodiazepine, 9-chloro-2,3,4,5-tetrahydro-, hydrochloride (1:2) REF: IN-DA000HC7CAS: 1159823-84-3	- - -	To inquire	Tue 04 Mar 25
9-Chloro-2,3,4,5-tetrahydro-1H-benzo[e][1,4]diazepine 2HCl REF: 10-F049303CAS: 1159823-84-3	95.0%	To inquire	Wed 12 Mar 25
9-Chloro-2,3,4,5-tetrahydro-1H-benzo[e][1,4]diazepine dihydrochloride REF: 10-F696088CAS: 1159823-84-3	97%	- - -	Discontinued product
9-Chloro-2,3,4,5-tetrahydro-1H-benzo[e][1,4]diazepine 2HCl REF: 3D-JWB82384CAS: 1159823-84-3	Min. 95%	- - -	Discontinued product