CAS 1159942-71-8: 4-(4-Methyl-2-thiazolyl)-1H-pyrazol-3-amine
Description:4-(4-Methyl-2-thiazolyl)-1H-pyrazol-3-amine is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a thiazole moiety. The presence of the methyl group on the thiazole ring contributes to its hydrophobic characteristics, while the amino group on the pyrazole provides potential for hydrogen bonding and reactivity. This compound is typically classified as an organic heterocyclic compound, and its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The thiazole and pyrazole rings are known for their biological activity, which may include antimicrobial, anti-inflammatory, or anticancer properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its synthesis may involve various organic reactions, including condensation and substitution reactions, making it of interest for synthetic chemists. Overall, 4-(4-Methyl-2-thiazolyl)-1H-pyrazol-3-amine represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C7H8N4S
InChI:InChI=1S/C7H8N4S/c1-4-3-12-7(10-4)5-2-9-11-6(5)8/h2-3H,1H3,(H3,8,9,11)
InChI key:InChIKey=NKIPKFWIXYDXIL-UHFFFAOYSA-N
SMILES:N=1NC=C(C2=NC(=CS2)C)C1N
- Synonyms:
- 4-(4-Methyl-2-thiazolyl)-1H-pyrazol-3-amine
- 1H-Pyrazol-3-amine, 4-(4-methyl-2-thiazolyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(4-Methyl-1,3-thiazol-2-yl)-1H-pyrazol-5-amine REF: 3D-JWB94271CAS: 1159942-71-8 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 4-(4-Methyl-1,3-thiazol-2-yl)-1h-pyrazol-5-amine REF: 10-F665573CAS: 1159942-71-8 | 95% | - - - | Discontinued product |

4-(4-Methyl-1,3-thiazol-2-yl)-1H-pyrazol-5-amine
Ref: 3D-JWB94271
1g | 1,126.00 € | ||
100mg | 450.00 € |

4-(4-Methyl-1,3-thiazol-2-yl)-1h-pyrazol-5-amine
Ref: 10-F665573
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |