CAS 1160248-96-3: 6-(1,1-Dimethylpropyl)benzo[b]thiophene-3-carbonyl chloride
Description:6-(1,1-Dimethylpropyl)benzo[b]thiophene-3-carbonyl chloride is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with a carbonyl chloride group and a bulky 1,1-dimethylpropyl group. This compound is likely to exhibit properties typical of carbonyl chlorides, such as reactivity towards nucleophiles due to the electrophilic nature of the carbonyl carbon. The presence of the thiophene ring may impart additional aromatic stability and influence its electronic properties. The bulky substituent can affect the compound's steric hindrance, potentially impacting its reactivity and interactions with other molecules. As a carbonyl chloride, it may be used in synthetic organic chemistry for acylation reactions or as an intermediate in the synthesis of more complex molecules. Safety considerations are important, as carbonyl chlorides can be corrosive and may release harmful gases upon reaction with water or alcohols. Overall, this compound's characteristics make it a valuable entity in chemical synthesis and research applications.
Formula:C14H15ClOS
InChI:InChI=1S/C14H15ClOS/c1-4-14(2,3)9-5-6-10-11(13(15)16)8-17-12(10)7-9/h5-8H,4H2,1-3H3
InChI key:InChIKey=UHIIXZYVBNUBDF-UHFFFAOYSA-N
SMILES:O=C(Cl)C1=CSC=2C=C(C=CC21)C(C)(C)CC
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6-(1,1-dimethylpropyl)-1-benzothiophene-3-carbonyl chloride REF: 10-F368799CAS: 1160248-96-3 | - - - | - - - | Discontinued product |
![]() | 6-(1,1-Dimethylpropyl)-1-benzothiophene-3-carbonyl chloride REF: 3D-FD121126CAS: 1160248-96-3 | Min. 95% | - - - | Discontinued product |

6-(1,1-dimethylpropyl)-1-benzothiophene-3-carbonyl chloride
Ref: 10-F368799
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

6-(1,1-Dimethylpropyl)-1-benzothiophene-3-carbonyl chloride
Ref: 3D-FD121126
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |