CAS 1160254-23-8: 8-Methyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride

Description: 8-Methyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its quinoline structure, which features a methyl group and a propylphenyl substituent. This compound contains a carbonyl chloride functional group, making it a reactive species, particularly in nucleophilic substitution reactions. The presence of the quinoline moiety suggests potential applications in medicinal chemistry, as quinolines are known for their biological activity, including antimicrobial and antimalarial properties. The compound's molecular structure indicates it may exhibit unique physical and chemical properties, such as solubility in organic solvents and stability under specific conditions. Its reactivity as an acyl chloride allows for further derivatization, which can be useful in the synthesis of more complex molecules. Safety considerations should be taken into account due to the potential hazards associated with carbonyl chlorides, including toxicity and reactivity with water. Overall, 8-Methyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride represents a versatile building block in organic synthesis and pharmaceutical development.

Formula: C₂₀H₁₈ClNO

InChI: InChI=1S/C20H18ClNO/c1-3-5-14-8-10-15(11-9-14)18-12-17(20(21)23)16-7-4-6-13(2)19(16)22-18/h4,6-12H,3,5H2,1-2H3

InChI key: InChIKey=MQQVRILAIYGVLR-UHFFFAOYSA-N

SMILES: O=C(Cl)C=1C=C(N=C2C1C=CC=C2C)C=3C=CC(=CC3)CCC

8-methyl-2-(4-propylphenyl)quinoline-4-carbonyl chloride

CAS: 1160254-23-8

• Molecular weight: 323.82000732421875

8-Methyl-2-(4-propylphenyl)quinoline-4-carbonyl chloride

CAS: 1160254-23-8

Please enquire for more information about 8-Methyl-2-(4-propylphenyl)quinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₂₀H₁₈ClNO
• Purity: Min. 95%
• Molecular weight: 323.82 g/mol