CAS 1160254-83-0: 2-(5-Ethyl-2-thienyl)-6,8-dimethyl-4-quinolinecarbonyl chloride
Description:2-(5-Ethyl-2-thienyl)-6,8-dimethyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with both thienyl and ethyl groups. This compound features a carbonyl chloride functional group, making it a reactive species that can participate in various chemical reactions, particularly acylation and nucleophilic substitution. The presence of multiple methyl groups contributes to its hydrophobic nature, potentially influencing its solubility in organic solvents. The thienyl group introduces heteroatoms into the structure, which can affect the compound's electronic properties and reactivity. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthesizing other complex molecules. As with many chlorinated compounds, it is essential to handle it with care, considering its reactivity and potential environmental impact. Proper safety measures should be observed when working with this substance in a laboratory setting.
Formula:C18H16ClNOS
InChI:InChI=1S/C18H16ClNOS/c1-4-12-5-6-16(22-12)15-9-14(18(19)21)13-8-10(2)7-11(3)17(13)20-15/h5-9H,4H2,1-3H3
InChI key:InChIKey=CQLHJNJNQCBXTF-UHFFFAOYSA-N
SMILES:O=C(Cl)C1=CC(=NC=2C1=CC(=CC2C)C)C=3SC(=CC3)CC
- Synonyms:
- 4-Quinolinecarbonyl chloride, 2-(5-ethyl-2-thienyl)-6,8-dimethyl-
- 2-(5-Ethyl-2-thienyl)-6,8-dimethyl-4-quinolinecarbonyl chloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(5-ethyl-2-thienyl)-6,8-dimethylquinoline-4-carbonyl chloride REF: 10-F368453CAS: 1160254-83-0 | - - - | - - - | Discontinued product |
![]() | 2-(5-Ethyl-2-thienyl)-6,8-dimethylquinoline-4-carbonyl chloride REF: 3D-FE120776CAS: 1160254-83-0 | Min. 95% | - - - | Discontinued product |

2-(5-ethyl-2-thienyl)-6,8-dimethylquinoline-4-carbonyl chloride
Ref: 10-F368453
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

2-(5-Ethyl-2-thienyl)-6,8-dimethylquinoline-4-carbonyl chloride
Ref: 3D-FE120776
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |