CAS 1160260-80-9: 2-(3,4,5-Trimethoxyphenyl)-4-quinolinecarbonyl chloride

Description: 2-(3,4,5-Trimethoxyphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a trimethoxyphenyl group. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, particularly acylation. The presence of multiple methoxy groups on the phenyl ring enhances its solubility in organic solvents and may influence its reactivity and biological activity. The quinoline structure is known for its applications in medicinal chemistry, often exhibiting pharmacological properties such as antimicrobial and antitumor activities. The compound's reactivity as an acyl chloride allows it to be used in the synthesis of other organic compounds, making it valuable in research and industrial applications. Safety precautions should be taken when handling this compound due to its potential reactivity and toxicity associated with acyl chlorides. Overall, this compound represents a significant interest in both synthetic organic chemistry and pharmaceutical development.

Formula: C₁₉H₁₆ClNO₄

InChI: InChI=1S/C19H16ClNO4/c1-23-16-8-11(9-17(24-2)18(16)25-3)15-10-13(19(20)22)12-6-4-5-7-14(12)21-15/h4-10H,1-3H3

InChI key: InChIKey=LAPRGRKCBMDGDL-UHFFFAOYSA-N

SMILES: O=C(Cl)C1=CC(=NC=2C=CC=CC21)C=3C=C(OC)C(OC)=C(OC)C3

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(3,4,5-trimethoxyphenyl)-
• 2-(3,4,5-Trimethoxyphenyl)-4-quinolinecarbonyl chloride

2-(3,4,5-trimethoxyphenyl)quinoline-4-carbonyl chloride

CAS: 1160260-80-9

• Molecular weight: 357.7900085449219

2-(3,4,5-Trimethoxyphenyl)quinoline-4-carbonyl chloride

CAS: 1160260-80-9

Please enquire for more information about 2-(3,4,5-Trimethoxyphenyl)quinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₁₉H₁₆ClNO₄
• Purity: Min. 95%
• Molecular weight: 357.79 g/mol