![6,8-Dimethyl-2-[2-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride](https://static.cymitquimica.com/cas-image/112221-68-dimethyl-2-2-1-methylethoxy-phenyl-4-quinolinecarbonyl-chloride.png)
CAS 1160263-01-3: 6,8-Dimethyl-2-[2-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride
Description:6,8-Dimethyl-2-[2-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline ring system and various substituents that contribute to its chemical properties. The presence of the carbonyl chloride functional group indicates that it can participate in nucleophilic acyl substitution reactions, making it a potentially reactive compound in organic synthesis. The dimethyl groups at the 6 and 8 positions of the quinoline ring enhance its lipophilicity, which may influence its solubility and biological activity. The ethoxy group attached to the phenyl ring suggests that the compound may exhibit interesting interactions with biological targets, potentially leading to applications in pharmaceuticals or agrochemicals. Additionally, the compound's molecular structure may impart specific optical or electronic properties, making it of interest in materials science. Overall, the unique combination of functional groups and structural features positions this compound as a versatile candidate for further research and development in various chemical applications.
Formula:C21H20ClNO2
InChI:InChI=1S/C21H20ClNO2/c1-12(2)25-19-8-6-5-7-15(19)18-11-17(21(22)24)16-10-13(3)9-14(4)20(16)23-18/h5-12H,1-4H3
InChI key:InChIKey=GICMVYGVBLMISM-UHFFFAOYSA-N
SMILES:O=C(Cl)C=1C=C(N=C2C1C=C(C=C2C)C)C=3C=CC=CC3OC(C)C
- Synonyms:
- 4-Quinolinecarbonyl chloride, 6,8-dimethyl-2-[2-(1-methylethoxy)phenyl]-
- 6,8-Dimethyl-2-[2-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-(2-isopropoxyphenyl)-6,8-dimethylquinoline-4-carbonyl chloride REF: 10-F368490CAS: 1160263-01-3 | - - - | - - - | Discontinued product |
 | 2-(2-Isopropoxyphenyl)-6,8-dimethylquinoline-4-carbonyl chloride REF: 3D-FI120813CAS: 1160263-01-3 | Min. 95% | - - - | Discontinued product |
2-(2-isopropoxyphenyl)-6,8-dimethylquinoline-4-carbonyl chloride
Ref: 10-F368490
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
2-(2-Isopropoxyphenyl)-6,8-dimethylquinoline-4-carbonyl chloride
Ref: 3D-FI120813
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
