CAS 1160264-63-0: 2-(4-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride

Description: 2-(4-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system substituted with a methoxyphenyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The methoxy group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the quinoline moiety is often associated with various pharmacological properties, including antimicrobial and antitumor activities. The compound's synthesis and handling require careful consideration due to the reactivity of the carbonyl chloride, which can release hydrochloric acid upon hydrolysis. Overall, this compound represents a class of organic molecules that may have significant applications in drug development and chemical synthesis.

Formula: C₁₈H₁₄ClNO₂

InChI: InChI=1S/C18H14ClNO2/c1-11-3-8-16-14(9-11)15(18(19)21)10-17(20-16)12-4-6-13(22-2)7-5-12/h3-10H,1-2H3

InChI key: InChIKey=UUGWRILBSRYAQR-UHFFFAOYSA-N

SMILES: O=C(Cl)C1=CC(=NC=2C=CC(=CC21)C)C=3C=CC(OC)=CC3

Synonyms:

• 2-(4-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(4-methoxyphenyl)-6-methyl-

2-(4-methoxyphenyl)-6-methylquinoline-4-carbonyl chloride

CAS: 1160264-63-0

• Molecular weight: 311.7699890136719

2-(4-Methoxyphenyl)-6-methylquinoline-4-carbonyl chloride

CAS: 1160264-63-0

Please enquire for more information about 2-(4-Methoxyphenyl)-6-methylquinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₁₈H₁₄ClNO₂
• Purity: Min. 95%
• Molecular weight: 311.76 g/mol