CAS 1160293-25-3: 1-(2-chloroacetyl)-2-oxo-2,3-dihydro-1H-indole-6-carboxylic acid methyl ester
Description:1-(2-Chloroacetyl)-2-oxo-2,3-dihydro-1H-indole-6-carboxylic acid methyl ester is a chemical compound characterized by its complex structure, which includes an indole ring fused with a carboxylic acid and an ester functional group. The presence of a chloroacetyl group introduces a halogen, which can influence the compound's reactivity and biological activity. This compound is likely to exhibit properties typical of indole derivatives, such as potential pharmacological activity, including antimicrobial or anticancer effects, due to the indole moiety's known bioactivity. The methyl ester group suggests that the compound may be more lipophilic, potentially enhancing its membrane permeability. Additionally, the presence of the keto group contributes to its reactivity, making it a candidate for further chemical modifications. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and drug development, although specific applications would depend on further research and characterization.
Formula:C12H10ClNO4
InChI:InChI=1S/C12H10ClNO4/c1-18-12(17)8-3-2-7-5-10(15)14(9(7)4-8)11(16)6-13/h2-4H,5-6H2,1H3
InChI key:InChIKey=XTJVECSKUSTBFN-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC=C2C(=C1)N(C(=O)CCl)C(=O)C2
1-(2-chloroacetyl)-2-oxo-2,3-dihydro-1H-indole-6-carboxylic acid methyl ester
Ref: IN-DA008TL0
| 100mg | 195.00 € |
Methyl 1-(2-chloroacetyl)-2-oxoindoline-6-carboxylate
Ref: 54-OR84940
| 100mg | 244.00 € | ||
| 250mg | 462.00 € |
Methyl 1-(2-chloroacetyl)-2-hydroxy-1H-indole-6-carboxylate
Ref: 10-F790037
| 100mg | 128.00 € | ||
| 250mg | 247.00 € |
Methyl 1-(2-chloroacetyl)-2-oxoindoline-6-carboxylate
Ref: 3D-KWB29325
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
