CAS 1160575-04-1: 1,5-Dibromo-2-iodo-3-(1-methylethyl)benzene

Description: 1,5-Dibromo-2-iodo-3-(1-methylethyl)benzene is an organic compound characterized by the presence of bromine and iodine substituents on a benzene ring, along with an isopropyl group. The compound features two bromine atoms located at the 1 and 5 positions and an iodine atom at the 2 position of the benzene ring, which contributes to its reactivity and potential applications in organic synthesis. The isopropyl group at the 3 position adds steric bulk, influencing the compound's physical properties and reactivity. This compound is likely to be a solid at room temperature, exhibiting typical aromatic characteristics such as stability and resonance. Its halogen substituents can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in the synthesis of more complex organic molecules. Additionally, the presence of multiple halogens may impart unique properties, such as increased polarity and potential biological activity, which could be of interest in medicinal chemistry and materials science.

Formula: C₉H₉Br₂I

InChI: InChI=1S/C9H9Br2I/c1-5(2)7-3-6(10)4-8(11)9(7)12/h3-5H,1-2H3

InChI key: InChIKey=ACAFALRTQYMSKN-UHFFFAOYSA-N

SMILES: BrC=1C=C(Br)C(I)=C(C1)C(C)C

Synonyms:

• 1,5-Dibromo-2-iodo-3-(1-methylethyl)benzene
• Benzene, 1,5-dibromo-2-iodo-3-(1-methylethyl)-

1,5-dibromo-2-iodo-3-(propan-2-yl)benzene

CAS: 1160575-04-1

• Formula: C₉H₉Br₂I
• Purity: 95%
• Molecular weight: 403.8802

1,5-Dibromo-2-iodo-3-isopropylbenzene

CAS: 1160575-04-1

• Purity: 98%
• Molecular weight: 403.88299560546875