CAS 1160756-76-2: [S(S)]-N-[(1R)-1-Cyclopropyl-2,2,2-trifluoroethyl]-2-methyl-2-propanesulfinamide

Description:The chemical substance known as [S(S)]-N-[(1R)-1-Cyclopropyl-2,2,2-trifluoroethyl]-2-methyl-2-propanesulfinamide, with the CAS number 1160756-76-2, is characterized by its sulfinamide functional group, which features a sulfur atom bonded to both an amine and a sulfonyl group. This compound exhibits chirality due to the presence of a cyclopropyl group and a trifluoroethyl substituent, contributing to its potential biological activity. The trifluoroethyl group enhances lipophilicity, which may influence the compound's pharmacokinetic properties. The sulfinamide structure is known for its role in medicinal chemistry, particularly in the development of pharmaceuticals, as it can exhibit various biological activities, including antimicrobial and anti-inflammatory effects. Additionally, the presence of multiple functional groups suggests that this compound may participate in diverse chemical reactions, making it a candidate for further research in drug development and synthesis. Its stability, solubility, and reactivity would depend on the specific conditions under which it is studied.

Formula:C₉H₁₆F₃NOS

InChI:InChI=1S/C9H16F3NOS/c1-8(2,3)15(14)13-7(6-4-5-6)9(10,11)12/h6-7,13H,4-5H2,1-3H3/t7-,15+/m1/s1

InChI key:InChIKey=WXRNWDHBHUQISH-MLXNANBUSA-N

SMILES:O=S(NC(C1CC1)C(F)(F)F)C(C)(C)C

Synonyms:
2-Propanesulfinamide, N-[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]-2-methyl-, [S(S)]-
[S(S)]-N-[(1R)-1-Cyclopropyl-2,2,2-trifluoroethyl]-2-methyl-2-propanesulfinamide