CAS 1161009-88-6: 4-Bromo-9,9′-spirobi[9H-fluorene]
Description:4-Bromo-9,9′-spirobi[9H-fluorene] is an organic compound characterized by its unique spirobifluorene structure, which consists of two fluorene units connected by a spiro carbon atom. The presence of a bromine atom at the 4-position of one of the fluorene rings introduces halogen functionality, which can influence the compound's reactivity and solubility. This compound typically exhibits a high degree of thermal stability and can be used in various applications, including organic electronics and materials science, due to its potential as a semiconductor. Its molecular structure contributes to interesting optical properties, making it a candidate for use in light-emitting devices. Additionally, the bromine substituent can facilitate further chemical modifications, enhancing its utility in synthetic chemistry. Overall, 4-Bromo-9,9′-spirobi[9H-fluorene] is notable for its structural complexity and potential applications in advanced materials.
Formula:C25H15Br
InChI:InChI=1S/C25H15Br/c26-23-15-7-14-22-24(23)18-10-3-6-13-21(18)25(22)19-11-4-1-8-16(19)17-9-2-5-12-20(17)25/h1-15H
InChI key:InChIKey=GQXFSXMUBDPXBG-UHFFFAOYSA-N
SMILES:BrC1=CC=CC2=C1C3=CC=CC=C3C42C=5C=CC=CC5C=6C=CC=CC64
- Synonyms:
- 4-Bromo-9,9'-Spirobifluorene
- 4-Bromo-9,9′-spirobi[fluorene]
- 4-Bromospiro[fluorene-9,9′-fluorene]
- 4-bromo-9,9'-Spirobi(9H-fluorene)
- 9,9′-Spirobi[9H-fluorene], 4-bromo-
- See more synonyms

4-Bromo-9,9'-spirobi[9H-fluorene]
Ref: 3B-B5031
1g | 67.00 € | ||
5g | 215.00 € |

9,9'-Spirobi[9H-fluorene], 4-bromo-
Ref: IN-DA000BN9
1g | 25.00 € | ||
5g | 41.00 € | ||
10g | 56.00 € | ||
100g | 252.00 € |

4-Bromo-9,9'-spirobi[9H-fluorene]
Ref: 54-OR51009
1g | 32.00 € | ||
5g | 38.00 € | ||
25g | 107.00 € |

4-Bromo-9,9'-spirobi[9H-fluorene]
Ref: 10-F514031
5g | 27.00 € | ||
10g | 53.00 € | ||
25g | 108.00 € |

4-Bromo-9,9'-spirobi[9H-fluorene]
Ref: 3D-LWB00988
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |