CAS 116293-90-4: 6-fluoroquinoline-3-carboxylic acid

Description:6-Fluoroquinoline-3-carboxylic acid is a chemical compound belonging to the quinoline family, characterized by a bicyclic structure that includes a nitrogen atom in the aromatic ring. This compound features a fluorine substituent at the 6-position and a carboxylic acid group at the 3-position, which contributes to its acidic properties. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry, particularly in the development of antimicrobial and antiviral agents. The carboxylic acid functional group allows for potential interactions in biological systems, such as hydrogen bonding and ionic interactions. Additionally, 6-fluoroquinoline-3-carboxylic acid may exhibit various physical properties, including solubility in polar solvents, which can be relevant for its application in pharmaceutical formulations. Its unique structural features and functional groups make it a valuable compound for research and development in various chemical and biological fields.

Formula:C₁₀H₆FNO₂

InChI:InChI=1/C10H6FNO2/c11-8-1-2-9-6(4-8)3-7(5-12-9)10(13)14/h1-5H,(H,13,14)

Synonyms:
3-Quinolinecarboxylic acid, 6-fluoro-
6-Fluoro-3-quinolinecarboxylic acid
T66 Bnj Dvq Hf
6-Fluoroquinoline-3-carboxylic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3-Quinolinecarboxylic acid, 6-fluoro- REF: IN-DA000C4JCAS: 116293-90-4	98%	To inquire	Tue 04 Mar 25
6-Fluoroquinoline-3-carboxylic acid REF: 54-PC49031CAS: 116293-90-4	0.98	34.00 €~1,025.00 €	Mon 03 Mar 25
6-FLUOROQUINOLINE-3-CARBOXYLIC ACID REF: 10-F305259CAS: 116293-90-4	95.0%	To inquire	Wed 12 Mar 25
6-Fluoro-3-Quinolinecarboxylic Acid REF: 3D-FF82350CAS: 116293-90-4	Min. 95%	- - -	Discontinued product