CAS 1167055-68-6: 4-(Bromomethyl)-2-methylpyridine
Description:4-(Bromomethyl)-2-methylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromomethyl group at the 4-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to the hydrophobic nature of the aromatic ring. The bromomethyl group makes it a versatile intermediate in organic synthesis, allowing for various substitution reactions. Additionally, the nitrogen atom in the pyridine ring can participate in coordination with metal ions, making this compound of interest in coordination chemistry. Safety precautions should be taken when handling this substance, as brominated compounds can be hazardous. Overall, 4-(Bromomethyl)-2-methylpyridine is a valuable compound in synthetic organic chemistry and materials science.
Formula:C7H8BrN
InChI:InChI=1S/C7H8BrN/c1-6-4-7(5-8)2-3-9-6/h2-4H,5H2,1H3
InChI key:InChIKey=MVVGGQWHXOPXRQ-UHFFFAOYSA-N
SMILES:BrCC=1C=CN=C(C1)C
- Synonyms:
- 2-Methyl-4-(bromomethyl)pyridine
- Pyridine, 4-(bromomethyl)-2-methyl-
- 4-(Bromomethyl)-2-methylpyridine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Pyridine, 4-(bromomethyl)-2-methyl- REF: IN-DA000D21CAS: 1167055-68-6 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 2-Methyl-4-(bromomethyl)pyridine REF: TR-M295285CAS: 1167055-68-6 | - - - | 1,136.00 € | Wed 07 May 25 |
![]() | 4-(Bromomethyl)-2-methylpyridine REF: 10-F687673CAS: 1167055-68-6 | 98% | - - - | Discontinued product |
![]() | 4-(Bromomethyl)-2-methylpyridine REF: 3D-SWB05568CAS: 1167055-68-6 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA000D21
Undefined size | To inquire |

2-Methyl-4-(bromomethyl)pyridine
Controlled ProductRef: TR-M295285
2500mg | 1,136.00 € |

Ref: 10-F687673
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

4-(Bromomethyl)-2-methylpyridine
Ref: 3D-SWB05568
1g | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |