CAS 1167056-96-3: 3-Bromo-5-chloro-1H-pyrrolo[2,3-c]pyridine
Description:3-Bromo-5-chloro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 3 and 5 positions, respectively, enhances its reactivity and potential for further chemical modifications. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, making it suitable for various synthetic applications. Its structure allows for potential interactions with biological targets, which may be of interest in medicinal chemistry and drug development. The compound's reactivity can be attributed to the electron-withdrawing nature of the halogen substituents, which can influence its electrophilic and nucleophilic behavior. Additionally, the presence of nitrogen atoms in the ring system may impart basicity, affecting its interaction with acids and bases. Overall, 3-Bromo-5-chloro-1H-pyrrolo[2,3-c]pyridine is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C7H4BrClN2
InChI:InChI=1S/C7H4BrClN2/c8-5-2-10-6-3-11-7(9)1-4(5)6/h1-3,10H
InChI key:InChIKey=AACITGQBOLOMOP-UHFFFAOYSA-N
SMILES:ClC=1N=CC=2NC=C(Br)C2C1
- Synonyms:
- 1H-Pyrrolo[2,3-c]pyridine, 3-bromo-5-chloro-
- 3-Bromo-5-chloro-6-azaindole
- 3-Bromo-5-chloro-1H-pyrrolo[2,3-c]pyridine

1H-Pyrrolo[2,3-c]pyridine, 3-bromo-5-chloro-
Ref: IN-DA000D4C
1g | 146.00 € | ||
5g | 470.00 € | ||
100mg | 34.00 € | ||
250mg | 60.00 € |

Ref: 54-OR76469
1g | 173.00 € | ||
5g | 752.00 € | ||
25g | 3,400.00 € | ||
100mg | 32.00 € | ||
250mg | 54.00 € |

3-Bromo-5-chloro-1H-pyrrolo[2,3-c]pyridine
Ref: 10-F243990
1g | 119.00 € | ||
5g | 516.00 € | ||
10g | 1,016.00 € | ||
250mg | 34.00 € |

3-Bromo-5-chloro-1H-pyrrolo[2,3-c]pyridine
Ref: 3D-SWB05696
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |