CAS 116754-85-9: 3-METHYL-15-PHENYLPENTADECANOIC ACID METHYL ESTER
Description:3-Methyl-15-phenylpentadecanoic acid methyl ester, with the CAS number 116754-85-9, is an organic compound characterized by its long carbon chain structure, which includes a methyl group and a phenyl group. This compound belongs to the class of fatty acid methyl esters, which are typically derived from natural fats and oils. The presence of the methyl ester functional group indicates that it is a derivative of a fatty acid, making it potentially useful in various applications, including as a surfactant, in biodiesel production, or in the synthesis of other organic compounds. The phenyl group contributes to its aromatic characteristics, which may influence its solubility and reactivity. Generally, compounds like this can exhibit hydrophobic properties due to their long hydrocarbon chains, while the ester functional group can provide some degree of polarity. The specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases for precise applications and handling guidelines.
Formula:C23H38O2
InChI:InChI=1/C23H38O2/c1-21(20-23(24)25-2)16-12-9-7-5-3-4-6-8-10-13-17-22-18-14-11-15-19-22/h11,14-15,18-19,21H,3-10,12-13,16-17,20H2,1-2H3
- Synonyms:
- Methyl Beta-Methylbenzenepentadecanoate
- Methyl 3-Methyl-15-Phenylpentadecanoate
- Beta-Methylbenzenepentadecanoic Acid Methyl Ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-METHYL-15-PHENYLPENTADECANOIC ACID METHYL ESTER REF: IN-DA003JOFCAS: 116754-85-9 | - - - | To inquire | Thu 27 Mar 25 |
![]() | Methyl 3-Methyl-15-phenylpentadecanoate REF: 3B-M1407CAS: | >95.0%(GC) | 233.00 € | Tue 01 Apr 25 |

Ref: IN-DA003JOF
Undefined size | To inquire |

Methyl 3-Methyl-15-phenylpentadecanoate
Ref: 3B-M1407
100mg | 233.00 € |