
CAS 117-86-2: 3-Nitro-1,5-naphthalenedisulfonic acid
Description:3-Nitro-1,5-naphthalenedisulfonic acid is an organic compound characterized by its naphthalene backbone, which is substituted with two sulfonic acid groups and one nitro group. This compound is typically a dark-colored solid that is soluble in water, owing to the presence of the sulfonic acid groups, which enhance its polarity. It exhibits acidic properties due to the sulfonic acid functionalities, making it useful in various applications, including as a dye intermediate and in the synthesis of other chemical compounds. The nitro group introduces additional reactivity, allowing for further chemical modifications. 3-Nitro-1,5-naphthalenedisulfonic acid is also known for its potential use in analytical chemistry, particularly in the development of colorimetric assays. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is significant in both industrial and research contexts due to its unique structural features and reactivity.
Formula:C10H7NO8S2
InChI:InChI=1S/C10H7NO8S2/c12-11(13)6-4-8-7(10(5-6)21(17,18)19)2-1-3-9(8)20(14,15)16/h1-5H,(H,14,15,16)(H,17,18,19)
InChI key:InChIKey=YDPFPDNDNZUKPL-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C=C2C(C=CC=C2S(=O)(=O)O)=C(C1)S(=O)(=O)O
- Synonyms:
- 3-Nitro naphthalene-1,5-disulphonic acid
- 2-Nitronaphthalene-4,8-disulfonic acid
- 1,5-Naphthalenedisulfonic acid, 3-nitro-
- 3-Nitro-1,5-naphthalenedisulfonic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1,5-Naphthalenedisulfonic acid, 3-nitro- REF: IN-DA000DJCCAS: 117-86-2 | - - - | To inquire | Wed 26 Mar 25 |
![]() | 3-Nitronaphthalene-1,5-disulfonic acid REF: 10-F756223CAS: 117-86-2 | 98% | - - - | Discontinued product |

Ref: IN-DA000DJC
Undefined size | To inquire |

Ref: 10-F756223
500mg | Discontinued | Request information |