
CAS 1171245-63-8: Ethyl 4-amino-2-(trifluoromethyl)benzoate
Description:Ethyl 4-amino-2-(trifluoromethyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. The presence of the trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. The amino group (-NH2) contributes to its basicity and can participate in hydrogen bonding, making it a versatile intermediate in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. The trifluoromethyl group is known for imparting unique electronic properties, which can enhance the compound's efficacy in various chemical reactions. Safety data should be consulted for handling and storage, as fluorinated compounds can pose specific health and environmental risks. Overall, Ethyl 4-amino-2-(trifluoromethyl)benzoate is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C10H10F3NO2
InChI:InChI=1S/C10H10F3NO2/c1-2-16-9(15)7-4-3-6(14)5-8(7)10(11,12)13/h3-5H,2,14H2,1H3
InChI key:InChIKey=WJUSTBDZBSDNOJ-UHFFFAOYSA-N
SMILES:O=C(OCC)C1=CC=C(N)C=C1C(F)(F)F
- Synonyms:
- Benzoic acid, 4-amino-2-(trifluoromethyl)-, ethyl ester
- Ethyl 4-amino-2-(trifluoromethyl)benzoate

Ethyl 4-amino-2-(trifluoromethyl)benzoate
Ref: IN-DA01FT8Q
1g | 49.00 € | ||
5g | 146.00 € | ||
10g | 207.00 € | ||
25g | 481.00 € | ||
250mg | 26.00 € |

Ref: 54-PC103844
5g | 261.00 € | ||
10g | 396.00 € | ||
25g | 892.00 € |

Ethyl 4-amino-2-(trifluoromethyl)benzoate
Ref: 10-F689626
5g | 115.00 € | ||
10g | 218.00 € | ||
25g | 468.00 € |

Ethyl 4-amino-2-(trifluoromethyl)benzoate
Ref: 3D-WWB24563
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |